S-(α-Fluorobenzyl)-S-phenyl-N-(p-tolylsulfonyl)sulfoximine structure
|
Common Name | S-(α-Fluorobenzyl)-S-phenyl-N-(p-tolylsulfonyl)sulfoximine | ||
|---|---|---|---|---|
| CAS Number | 1260143-68-7 | Molecular Weight | 403.49000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C20H18FNO3S2 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | N/A | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | S-(α-Fluorobenzyl)-S-phenyl-N-(p-tolylsulfonyl)sulfoximine |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C20H18FNO3S2 |
|---|---|
| Molecular Weight | 403.49000 |
| Exact Mass | 403.07100 |
| PSA | 80.33000 |
| LogP | 6.82560 |
| InChIKey | ZAGQEXRRSCLLFW-UHFFFAOYSA-N |
| SMILES | Cc1ccc(S(=O)(=O)N=S(=O)(c2ccccc2)C(F)c2ccccc2)cc1 |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335-H413 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| RIDADR | NONH for all modes of transport |
|
Efficient Synthesis and Ring-Opening Reactions of Monofluorinated Epoxides Derived from a-Fluorosulfoximines Zhang, W.; Hu, J.
Adv. Synth. Catal. 16th ed., 352 , 2799-2804, (2010)
|
| N-[[fluoro(phenyl)methyl]-oxo-phenyl-λ<sup>6</sup>-sulfanylidene]-4-methylbenzenesulfonamide |