2-(3,4-dimethylphenyl)-4H-isoquinoline-1,3-dione structure
|
Common Name | 2-(3,4-dimethylphenyl)-4H-isoquinoline-1,3-dione | ||
|---|---|---|---|---|
| CAS Number | 126070-10-8 | Molecular Weight | 265.30700 | |
| Density | 1.222g/cm3 | Boiling Point | 471.6ºC at 760mmHg | |
| Molecular Formula | C17H15NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 221.6ºC | |
| Name | 2-(3,4-dimethylphenyl)-4H-isoquinoline-1,3-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.222g/cm3 |
|---|---|
| Boiling Point | 471.6ºC at 760mmHg |
| Molecular Formula | C17H15NO2 |
| Molecular Weight | 265.30700 |
| Flash Point | 221.6ºC |
| Exact Mass | 265.11000 |
| PSA | 37.38000 |
| LogP | 3.09790 |
| Vapour Pressure | 4.61E-09mmHg at 25°C |
| Index of Refraction | 1.621 |
| InChIKey | MPKWXFVEWMZYHU-UHFFFAOYSA-N |
| SMILES | Cc1ccc(N2C(=O)Cc3ccccc3C2=O)cc1C |
|
~%
2-(3,4-dimethyl... CAS#:126070-10-8 |
| Literature: Modena, T.; Azzolina, O.; Genta, I.; Mazza, M. Farmaco, 1989 , vol. 44, # 7-8 p. 721 - 730 |
|
~%
2-(3,4-dimethyl... CAS#:126070-10-8 |
| Literature: Noguchi, Tomomi; Sano, Hiroko; Shimazawa, Rumiko; Tanatani, Aya; Miyachi, Hiroyuki; Hashimoto, Yuichi Bioorganic and Medicinal Chemistry Letters, 2004 , vol. 14, # 16 p. 4141 - 4145 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 2-(3,4-dimethylphenyl)-1,3(2H,4H)-isoquinolinedione |