Benzamide, 2-hydroxy-6-(trifluoromethoxy)
Modify Date: 2026-08-20 17:28:24
Benzamide, 2-hydroxy-6-(trifluoromethoxy) structure
|
Common Name | Benzamide, 2-hydroxy-6-(trifluoromethoxy) | ||
|---|---|---|---|---|
| CAS Number | 1261455-22-4 | Molecular Weight | 221.13 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H6F3NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Benzamide, 2-hydroxy-6-(trifluoromethoxy) |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C8H6F3NO3 |
|---|---|
| Molecular Weight | 221.13 |
| InChIKey | MEVYSRBOFHNZSW-UHFFFAOYSA-N |
| SMILES | NC(=O)c1c(O)cccc1OC(F)(F)F |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of Benzamide, 2-hydroxy-6-(trifluoromethoxy)? |
| A: InChIKey of Benzamide, 2-hydroxy-6-(trifluoromethoxy) is MEVYSRBOFHNZSW-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 1261455-22-4? |
| A: Chinese name of 1261455-22-4 is 1261455-22-4. |
| Q: What is the CAS number of Benzamide, 2-hydroxy-6-(trifluoromethoxy)? |
| A: CAS number of Benzamide, 2-hydroxy-6-(trifluoromethoxy) is 1261455-22-4. |
| Q: What is the molecular weight of Benzamide, 2-hydroxy-6-(trifluoromethoxy)? |
| A: Molecular weight of Benzamide, 2-hydroxy-6-(trifluoromethoxy) is 221.13. |
| Q: What is the English name of Benzamide, 2-hydroxy-6-(trifluoromethoxy)? |
| A: The English name of Benzamide, 2-hydroxy-6-(trifluoromethoxy) is Benzamide, 2-hydroxy-6-(trifluoromethoxy). |
| Q: What is the SMILES notation of Benzamide, 2-hydroxy-6-(trifluoromethoxy)? |
| A: SMILES notation of Benzamide, 2-hydroxy-6-(trifluoromethoxy) is NC(=O)c1c(O)cccc1OC(F)(F)F. |
| Q: What is the molecular formula of Benzamide, 2-hydroxy-6-(trifluoromethoxy)? |
| A: Molecular formula of Benzamide, 2-hydroxy-6-(trifluoromethoxy) is C8H6F3NO3. |