S-(+)-6-(2-Methyl-3-propenyl)-4,5,6,7-tetrahydro-5-methylimidazo(4,5,1-jk)(1,4)benzodiazepin-2(1H)-one structure
|
Common Name | S-(+)-6-(2-Methyl-3-propenyl)-4,5,6,7-tetrahydro-5-methylimidazo(4,5,1-jk)(1,4)benzodiazepin-2(1H)-one | ||
|---|---|---|---|---|
| CAS Number | 126233-94-1 | Molecular Weight | 257.33100 | |
| Density | 1.2g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C15H19N3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | S-(+)-6-(2-Methyl-3-propenyl)-4,5,6,7-tetrahydro-5-methylimidazo(4,5,1-jk)(1,4)benzodiazepin-2(1H)-one |
|---|
| Density | 1.2g/cm3 |
|---|---|
| Molecular Formula | C15H19N3O |
| Molecular Weight | 257.33100 |
| Exact Mass | 257.15300 |
| PSA | 41.29000 |
| LogP | 2.46000 |
| Index of Refraction | 1.626 |
| InChIKey | IIUBASIWSTXESN-NSHDSACASA-N |
| SMILES | C=C(C)CN1Cc2cccc3[nH]c(=O)n(c23)CC1C |
|
~%
S-(+)-6-(2-Meth... CAS#:126233-94-1 |
| Literature: Kukla, Michael J.; Breslin, Henry J.; Pauwels, Rudi; Fedde, Cynthia L.; Miranda, Milton; et al. Journal of Medicinal Chemistry, 1991 , vol. 34, # 2 p. 746 - 751 |
| Precursor 1 | |
|---|---|
| DownStream 1 | |