2-Amino-3-nitrobenzoic acid structure
|
Common Name | 2-Amino-3-nitrobenzoic acid | ||
|---|---|---|---|---|
| CAS Number | 606-18-8 | Molecular Weight | 182.133 | |
| Density | 1.6±0.1 g/cm3 | Boiling Point | 390.4±32.0 °C at 760 mmHg | |
| Molecular Formula | C7H6N2O4 | Melting Point | 207-211°C | |
| MSDS | Chinese USA | Flash Point | 189.9±25.1 °C | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 2-Amino-3-nitrobenzoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.6±0.1 g/cm3 |
|---|---|
| Boiling Point | 390.4±32.0 °C at 760 mmHg |
| Melting Point | 207-211°C |
| Molecular Formula | C7H6N2O4 |
| Molecular Weight | 182.133 |
| Flash Point | 189.9±25.1 °C |
| Exact Mass | 182.032761 |
| PSA | 109.14000 |
| LogP | 2.30 |
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
| Index of Refraction | 1.682 |
| InChIKey | JJPIVRWTAGQTPQ-UHFFFAOYSA-N |
| SMILES | Nc1c(C(=O)O)cccc1[N+](=O)[O-] |
| Storage condition | Refrigerator |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H302 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xn:Harmful; |
| Risk Phrases | R22 |
| RIDADR | NONH for all modes of transport |
| HS Code | 2942000000 |
| Precursor 9 | |
|---|---|
| DownStream 10 | |
| HS Code | 2922499990 |
|---|---|
| Summary | HS:2922499990 other amino-acids, other than those containing more than one kind of oxygen function, and their esters; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:6.5% General tariff:30.0% |
| WNR BZ CVQ |
| 3-Nitroanthranilic acid |
| MFCD00024261 |
| 2-Amino-3-nitrobenzoic acid |
| Benzoic acid, 2-amino-3-nitro- |