Ethyl 1-benzyl-4-bromo-5-methyl-1H-pyrazole-3-carboxylate structure
|
Common Name | Ethyl 1-benzyl-4-bromo-5-methyl-1H-pyrazole-3-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 1262415-66-6 | Molecular Weight | 323.185 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 429.9±45.0 °C at 760 mmHg | |
| Molecular Formula | C14H15BrN2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 213.8±28.7 °C | |
| Name | Ethyl 1-benzyl-4-bromo-5-methyl-1H-pyrazole-3-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 429.9±45.0 °C at 760 mmHg |
| Molecular Formula | C14H15BrN2O2 |
| Molecular Weight | 323.185 |
| Flash Point | 213.8±28.7 °C |
| Exact Mass | 322.031677 |
| PSA | 44.12000 |
| LogP | 3.25 |
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
| Index of Refraction | 1.594 |
| InChIKey | IPAVGAOABAMSIG-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1nn(Cc2ccccc2)c(C)c1Br |
| Hazard Codes | Xn |
|---|---|
| HS Code | 2933199090 |
| HS Code | 2933199090 |
|---|---|
| Summary | 2933199090. other compounds containing an unfused pyrazole ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1H-Pyrazole-3-carboxylic acid, 4-bromo-5-methyl-1-(phenylmethyl)-, ethyl ester |
| Ethyl 1-benzyl-4-bromo-5-methyl-1H-pyrazole-3-carboxylate |
| ethyl 1-benzyl-4-bromo-5-methylpyrazole-3-carboxylate |