Acetylene-PEG4-biotin conjugate structure
|
Common Name | Acetylene-PEG4-biotin conjugate | ||
|---|---|---|---|---|
| CAS Number | 1262681-31-1 | Molecular Weight | 457.58 | |
| Density | 1.158±0.06 g/cm3(Predicted) | Boiling Point | 707.1±60.0 °C(Predicted) | |
| Molecular Formula | C21H35N3O6S | Melting Point | 55-64 °C | |
| MSDS | N/A | Flash Point | 381.4±32.9 °C | |
Use of Acetylene-PEG4-biotin conjugate(3aS,4S,6aR)-Biotin-PEG4-Alkyne is an azide reactive compound[1]. |
| Name | Biotin-PEG4-Alkyne |
|---|---|
| Synonym | More Synonyms |
| Description | (3aS,4S,6aR)-Biotin-PEG4-Alkyne is an azide reactive compound[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.158±0.06 g/cm3(Predicted) |
|---|---|
| Boiling Point | 707.1±60.0 °C(Predicted) |
| Melting Point | 55-64 °C |
| Molecular Formula | C21H35N3O6S |
| Molecular Weight | 457.58 |
| Flash Point | 381.4±32.9 °C |
| Exact Mass | 457.224670 |
| LogP | -1.02 |
| Vapour Pressure | 0.0±2.2 mmHg at 25°C |
| Index of Refraction | 1.513 |
| InChIKey | SKMJWNZZFUDLKQ-BJLQDIEVSA-N |
| SMILES | C#CCOCCOCCOCCOCCNC(=O)CCCCC1SCC2NC(=O)NC21 |
| Storage condition | -20°C |
| Hazard Codes | Xi |
|---|
| MFCD22380755 |
| 5-[(3aS,4S,6aR)-2-Oxohexahydro-1H-thieno[3,4-d]imidazol-4-yl]-N-(3,6,9,12-tetraoxapentadec-14-yn-1-yl)pentanamide |
| 1H-Thieno[3,4-d]imidazole-4-pentanamide, hexahydro-2-oxo-N-3,6,9,12-tetraoxapentadec-14-yn-1-yl-, (3aS,4S,6aR)- |
| (3aS,4S,6aR)-Hexahydro-2-oxo-N-3,6,9,12-tetraoxapentadec-14-yn-1-yl-1H-thieno[3,4-d]imidazole-4-pentanamide |