Fmoc-1-aminocyclopropane-1-carboxylic acid structure
|
Common Name | Fmoc-1-aminocyclopropane-1-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 126705-22-4 | Molecular Weight | 323.343 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 566.9±29.0 °C at 760 mmHg | |
| Molecular Formula | C19H17NO4 | Melting Point | 225-226ºC | |
| MSDS | Chinese USA | Flash Point | 296.7±24.3 °C | |
| Name | 1-(Fmoc-amino)cyclopropanecarboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 566.9±29.0 °C at 760 mmHg |
| Melting Point | 225-226ºC |
| Molecular Formula | C19H17NO4 |
| Molecular Weight | 323.343 |
| Flash Point | 296.7±24.3 °C |
| Exact Mass | 323.115753 |
| PSA | 75.63000 |
| LogP | 3.04 |
| Vapour Pressure | 0.0±1.6 mmHg at 25°C |
| Index of Refraction | 1.671 |
| InChIKey | OPPOISJKHBLNPD-UHFFFAOYSA-N |
| SMILES | O=C(NC1(C(=O)O)CC1)OCC1c2ccccc2-c2ccccc21 |
| Storage condition | 2-8°C |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| Hazard Codes | Xi |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2924299090 |
|
~%
Fmoc-1-aminocyc... CAS#:126705-22-4 |
| Literature: Journal of the American Chemical Society, , vol. 125, # 23 p. 6852 - 6853 |
|
~%
Fmoc-1-aminocyc... CAS#:126705-22-4 |
| Literature: Tetrahedron Letters, , vol. 44, # 46 p. 8403 - 8406 |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Cyclopropanecarboxylic acid, 1-[[(9H-fluoren-9-ylmethoxy)carbonyl]amino]- |
| 1-{[(9H-Fluoren-9-ylmethoxy)carbonyl]amino}cyclopropanecarboxylic acid |
| N-Fmoc-1-amino-1-cyclopropanecarboxylic acid |
| N-Fmoc-1-Aminocyclopropanecarboxylic acid |
| Fmoc-1-aminocyclopropane-1-carboxylic acid |