2-[2-(3-Prop-1-en-2-ylphenyl)propan-2- ylcarbamoyloxy]ethyl methacrylate structure
|
Common Name | 2-[2-(3-Prop-1-en-2-ylphenyl)propan-2- ylcarbamoyloxy]ethyl methacrylate | ||
|---|---|---|---|---|
| CAS Number | 126710-08-5 | Molecular Weight | 331.406 | |
| Density | 1.1±0.0 g/cm3 | Boiling Point | 471.9±0.0 °C at 760 mmHg | |
| Molecular Formula | C19H25NO4 | Melting Point | N/A | |
| MSDS | USA | Flash Point | 239.2±0.0 °C | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 2-[2-(3-Prop-1-en-2-ylphenyl)propan-2-ylcarbamoyloxy]ethyl methacrylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1±0.0 g/cm3 |
|---|---|
| Boiling Point | 471.9±0.0 °C at 760 mmHg |
| Molecular Formula | C19H25NO4 |
| Molecular Weight | 331.406 |
| Flash Point | 239.2±0.0 °C |
| Exact Mass | 331.178345 |
| LogP | 4.83 |
| Vapour Pressure | 0.0±0.0 mmHg at 25°C |
| Index of Refraction | 1.510 |
| InChIKey | XZWLUVUMBIRBOF-UHFFFAOYSA-N |
| SMILES | C=C(C)C(=O)OCCOC(=O)NC(C)(C)c1cccc(C(=C)C)c1 |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Hazard Codes | Xi |
| RIDADR | NONH for all modes of transport |
| 2-[[[[1-Methyl-1-[3-(1-methylethenyl)phenyl]ethyl]amino]carbonyl]oxy]ethyl 2-methyl-2-propenoate |
| 2-[2-(3-Prop-1-en-2-ylphenyl)propan-2-ylcarbamoyloxy]ethyl methacrylate |
| 2-[2-(3-Prop-1-en-2-ylphenyl)propan-2-ylcarbamoyloxy]ethyl 2-methylprop-2-enoate |
| 2-Propenoic acid, 2-methyl-, 2-[[[[1-methyl-1-[3-(1-methylethenyl)phenyl]ethyl]amino]carbonyl]oxy]ethyl ester |
| 2-({[2-(3-Isopropenylphenyl)-2-propanyl]carbamoyl}oxy)ethyl methacrylate |