4-bromobenzenesulphonylacetonitrile structure
|
Common Name | 4-bromobenzenesulphonylacetonitrile | ||
|---|---|---|---|---|
| CAS Number | 126891-45-0 | Molecular Weight | 260.10800 | |
| Density | 1.653 g/cm3 | Boiling Point | 438ºC at 760 mmHg | |
| Molecular Formula | C8H6BrNO2S | Melting Point | 190-192ºC | |
| MSDS | USA | Flash Point | 218.7ºC | |
| Name | 2-(4-bromophenyl)sulfonylacetonitrile |
|---|---|
| Synonym | More Synonyms |
| Density | 1.653 g/cm3 |
|---|---|
| Boiling Point | 438ºC at 760 mmHg |
| Melting Point | 190-192ºC |
| Molecular Formula | C8H6BrNO2S |
| Molecular Weight | 260.10800 |
| Flash Point | 218.7ºC |
| Exact Mass | 258.93000 |
| PSA | 66.31000 |
| LogP | 2.82718 |
| Vapour Pressure | 7.16E-08mmHg at 25°C |
| Index of Refraction | 1.582 |
| InChIKey | KSKSEVVFIOHIAT-UHFFFAOYSA-N |
| SMILES | N#CCS(=O)(=O)c1ccc(Br)cc1 |
| Hazard Codes | Xi: Irritant; |
|---|---|
| HS Code | 2926909090 |
|
~%
4-bromobenzenes... CAS#:126891-45-0 |
| Literature: Journal fuer Praktische Chemie (Leipzig), , vol. <2> 71, p. 232 |
|
~%
4-bromobenzenes... CAS#:126891-45-0 |
| Literature: Journal of Medicinal Chemistry, , vol. 55, # 12 p. 5942 - 5950 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2926909090 |
|---|---|
| Summary | HS:2926909090 other nitrile-function compounds VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 4-bromo-phenylsulfonylacetonitrile |
| 4-Bromobenzenesulfonyl acetonitrile |
| 4-bromobenzenesulphonyl acetonitrile |
| F1673-4395 |
| MFCD00129455 |