N,N'-bis(3-methylbutyl)propanediamide structure
|
Common Name | N,N'-bis(3-methylbutyl)propanediamide | ||
|---|---|---|---|---|
| CAS Number | 126947-45-3 | Molecular Weight | 242.35800 | |
| Density | 0.947g/cm3 | Boiling Point | 444.9ºC at 760 mmHg | |
| Molecular Formula | C13H26N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 164.1ºC | |
| Name | N,N'-bis(3-methylbutyl)propanediamide |
|---|---|
| Synonym | More Synonyms |
| Density | 0.947g/cm3 |
|---|---|
| Boiling Point | 444.9ºC at 760 mmHg |
| Molecular Formula | C13H26N2O2 |
| Molecular Weight | 242.35800 |
| Flash Point | 164.1ºC |
| Exact Mass | 242.19900 |
| PSA | 65.18000 |
| LogP | 3.38170 |
| Vapour Pressure | 4.13E-08mmHg at 25°C |
| Index of Refraction | 1.455 |
| InChIKey | UCTJMAHVRZXADJ-UHFFFAOYSA-N |
| SMILES | CC(C)CCNC(=O)CC(=O)NCCC(C)C |
| HS Code | 2924199090 |
|---|
| HS Code | 2924199090 |
|---|---|
| Summary | 2924199090. other acyclic amides (including acyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| N,N'-BIS(3-METHYL-BUTYL)-MALONAMIDE |
| N,N'-diisopentyl-malonamide |
| Malonsaeure-bis-isopentylamid |