8-(4-CHLORO-PHENYL)-1,4-DIOXA-SPIRO[4.5]DECAN-8-OL structure
|
Common Name | 8-(4-CHLORO-PHENYL)-1,4-DIOXA-SPIRO[4.5]DECAN-8-OL | ||
|---|---|---|---|---|
| CAS Number | 126991-59-1 | Molecular Weight | 268.73600 | |
| Density | 1.3g/cm3 | Boiling Point | 408.4ºC at 760 mmHg | |
| Molecular Formula | C14H17ClO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 200.8ºC | |
| Name | 8-(4-chlorophenyl)-1,4-dioxaspiro[4.5]decan-8-ol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3g/cm3 |
|---|---|
| Boiling Point | 408.4ºC at 760 mmHg |
| Molecular Formula | C14H17ClO3 |
| Molecular Weight | 268.73600 |
| Flash Point | 200.8ºC |
| Exact Mass | 268.08700 |
| PSA | 38.69000 |
| LogP | 2.84470 |
| Vapour Pressure | 2.11E-07mmHg at 25°C |
| Index of Refraction | 1.591 |
| InChIKey | KPILSHSOLNVPLU-UHFFFAOYSA-N |
| SMILES | OC1(c2ccc(Cl)cc2)CCC2(CC1)OCCO2 |
|
~91%
8-(4-CHLORO-PHE... CAS#:126991-59-1 |
| Literature: WO2012/153162 A1, ; Page/Page column 36 ; |
|
~84%
8-(4-CHLORO-PHE... CAS#:126991-59-1 |
| Literature: Tetrahedron Letters, , vol. 39, # 42 p. 7629 - 7632 |
|
~%
8-(4-CHLORO-PHE... CAS#:126991-59-1 |
| Literature: Bioorganic and Medicinal Chemistry Letters, , vol. 15, # 22 p. 4910 - 4914 |
| Precursor 3 | |
|---|---|
| DownStream 6 | |
| o-Chlorophenyldiphenylmethanol |
| DIO011 |
| TRAM 3 |