Diphenyl sulfone structure
|
Common Name | Diphenyl sulfone | ||
|---|---|---|---|---|
| CAS Number | 127-63-9 | Molecular Weight | 218.272 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 378.5±11.0 °C at 760 mmHg | |
| Molecular Formula | C12H10O2S | Melting Point | 123-129 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | 226.8±11.9 °C | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | diphenyl sulfone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 378.5±11.0 °C at 760 mmHg |
| Melting Point | 123-129 °C(lit.) |
| Molecular Formula | C12H10O2S |
| Molecular Weight | 218.272 |
| Flash Point | 226.8±11.9 °C |
| Exact Mass | 218.040146 |
| PSA | 42.52000 |
| LogP | 2.40 |
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
| Index of Refraction | 1.593 |
| InChIKey | KZTYYGOKRVBIMI-UHFFFAOYSA-N |
| SMILES | O=S(=O)(c1ccccc1)c1ccccc1 |
| Water Solubility | insoluble |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
|
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H302-H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Faceshields;Gloves |
| Hazard Codes | Xi:Irritant |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S36-S37/39 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| RTECS | SX2400000 |
| HS Code | 2930909090 |
| Precursor 9 | |
|---|---|
| DownStream 10 | |
| HS Code | 2904100000 |
|---|---|
| Summary | 2904100000 derivatives containing only sulpho groups, their salts and ethyl esters。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
|
Calculating virtual log P in the alkane/water system (log P(N)(alk)) and its derived parameters deltalog P(N)(oct-alk) and log D(pH)(alk).
J. Med. Chem. 48 , 3269-79, (2005) Growing interest in the use of both the logarithm of the partition coefficient of the neutral species in the alkane/water system (log P(N)(alk)) and the difference between log P(N)(oct) (the logarithm... |
|
|
Toward prediction of alkane/water partition coefficients.
J. Med. Chem. 51 , 3720-30, (2008) Partition coefficients were measured for 47 compounds in the hexadecane/water ( P hxd) and 1-octanol/water ( P oct) systems. Some types of hydrogen bond acceptor presented by these compounds to the pa... |
|
|
Use of simple docking methods to screen a virtual library for heteroactivators of cytochrome P450 2C9.
J. Med. Chem. 50 , 1158-65, (2007) Several laboratories have demonstrated that activation of drug metabolism by P450s may occur via a mechanism that resembles allosterism from an enzyme kinetic standpoint. Because the effector drug bin... |
| sulfonyldibenzene |
| EINECS 204-853-1 |
| 1,1'-Sulfonyldibenzene |
| Diphenyl sulfone |
| 1,1’-sulfonyldibenzene |
| Benzene, 1,1'-sulfonylbis- |
| DIPHENYLSULFONE |
| Phenyl sulfone |
| 1,1’-sulfonylbisbenzene |
| Diphenylsulfon |
| MFCD00007548 |
| sulfone, diphenyl |
| benzenesulfonylbenzene |
| diphenyl sulphone |