3-(cyclohexen-1-ylmethyl)-2-hydroxy-4-methoxybenzaldehyde
3-(cyclohexen-1-ylmethyl)-2-hydroxy-4-methoxybenzaldehyde structure
|
Common Name | 3-(cyclohexen-1-ylmethyl)-2-hydroxy-4-methoxybenzaldehyde | ||
|---|---|---|---|---|
| CAS Number | 127462-79-7 | Molecular Weight | 246.30200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H18O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Summary: 3-(cyclohexen-1-ylmethyl)-2-hydroxy-4-methoxybenzaldehyde, CAS number: 127462-79-7, molecular formula: C15H18O3, molecular weight: 246.30200. For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3-(cyclohexen-1-ylmethyl)-2-hydroxy-4-methoxybenzaldehyde |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C15H18O3 |
|---|---|
| Molecular Weight | 246.30200 |
| Exact Mass | 246.12600 |
| PSA | 46.53000 |
| LogP | 3.25620 |
| InChIKey | LSGQVLGJHQRGAS-UHFFFAOYSA-N |
| SMILES | COc1ccc(C=O)c(O)c1CC1=CCCCC1 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 6 | |
|---|---|
| DownStream 0 | |
CAS#:18448-47-0
CAS#:150-19-6
CAS#:1617-22-7
CAS#:37677-17-1
CAS#:57234-28-3
CAS#:108-94-1This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of 3-(cyclohexen-1-ylmethyl)-2-hydroxy-4-methoxybenzaldehyde? |
| A: The English name of 3-(cyclohexen-1-ylmethyl)-2-hydroxy-4-methoxybenzaldehyde is 3-(cyclohexen-1-ylmethyl)-2-hydroxy-4-methoxybenzaldehyde. |
| Q: What is the SMILES notation of 3-(cyclohexen-1-ylmethyl)-2-hydroxy-4-methoxybenzaldehyde? |
| A: SMILES notation of 3-(cyclohexen-1-ylmethyl)-2-hydroxy-4-methoxybenzaldehyde is COc1ccc(C=O)c(O)c1CC1=CCCCC1. |
| Q: What is the polar surface area (PSA) of 3-(cyclohexen-1-ylmethyl)-2-hydroxy-4-methoxybenzaldehyde? |
| A: Polar surface area (PSA) of 3-(cyclohexen-1-ylmethyl)-2-hydroxy-4-methoxybenzaldehyde is 46.53000. |
| Q: What is the molecular weight of 3-(cyclohexen-1-ylmethyl)-2-hydroxy-4-methoxybenzaldehyde? |
| A: Molecular weight of 3-(cyclohexen-1-ylmethyl)-2-hydroxy-4-methoxybenzaldehyde is 246.30200. |
| Q: What is the Chinese name of 127462-79-7? |
| A: Chinese name of 127462-79-7 is 127462-79-7. |
| Q: What is the InChIKey of 3-(cyclohexen-1-ylmethyl)-2-hydroxy-4-methoxybenzaldehyde? |
| A: InChIKey of 3-(cyclohexen-1-ylmethyl)-2-hydroxy-4-methoxybenzaldehyde is LSGQVLGJHQRGAS-UHFFFAOYSA-N. |
| Q: What is the molecular formula of 3-(cyclohexen-1-ylmethyl)-2-hydroxy-4-methoxybenzaldehyde? |
| A: Molecular formula of 3-(cyclohexen-1-ylmethyl)-2-hydroxy-4-methoxybenzaldehyde is C15H18O3. |
| Q: What is the LogP of 3-(cyclohexen-1-ylmethyl)-2-hydroxy-4-methoxybenzaldehyde? |
| A: LogP of 3-(cyclohexen-1-ylmethyl)-2-hydroxy-4-methoxybenzaldehyde is 3.25620. |
| Q: What are the upstream materials of 3-(cyclohexen-1-ylmethyl)-2-hydroxy-4-methoxybenzaldehyde? |
| A: Related upstream materials(CAS) of 3-(cyclohexen-1-ylmethyl)-2-hydroxy-4-methoxybenzaldehyde: 18448-47-0;150-19-6;1617-22-7;37677-17-1;57234-28-3;108-94-1. |
| Q: What is the CAS number of 3-(cyclohexen-1-ylmethyl)-2-hydroxy-4-methoxybenzaldehyde? |
| A: CAS number of 3-(cyclohexen-1-ylmethyl)-2-hydroxy-4-methoxybenzaldehyde is 127462-79-7. |