2-Ethyl-6-methylpyridin-3-ol succinate structure
|
Common Name | 2-Ethyl-6-methylpyridin-3-ol succinate | ||
|---|---|---|---|---|
| CAS Number | 127464-43-1 | Molecular Weight | 255.267 | |
| Density | N/A | Boiling Point | 280.6ºC at 760 mmHg | |
| Molecular Formula | C12H17NO5 | Melting Point | 113 °C | |
| MSDS | N/A | Flash Point | 123.5ºC | |
Use of 2-Ethyl-6-methylpyridin-3-ol succinateEmoxypine succinate is an antioxidant. Emoxypine succinate can be used for the research of post-traumatic[1]. |
| Name | 2-Ethyl-6-methylpyridin-3-ol succinate |
|---|---|
| Synonym | More Synonyms |
| Description | Emoxypine succinate is an antioxidant. Emoxypine succinate can be used for the research of post-traumatic[1]. |
|---|---|
| Related Catalog | |
| In Vitro | Emoxypine succinate shows reactive oxygen species overproduction and disruption of the mitochondrial inner membrane due to the decreasing of transmembrane potential[1]. |
| In Vivo | Emoxypine succinate (i.p.; 40 mg/kg; 1 time per day, 14 days) decreases the production of reactive oxygen species, mitochondrial transmembrane potential percentage of leukocyte and the percentage of FITC Annexin V- positive cells of leukocyte suspension[1]. Animal Model: Rats[1] Dosage: 40 mg/kg Administration: Intraperitoneal, 1 time per day, 14 days Result: Significantly increased the percentage of Annexin V-positive cells, reduced the apoptotic percentage of white blood cells and decreased the production of reactive oxygen species by leukocytes. |
| References |
| Boiling Point | 280.6ºC at 760 mmHg |
|---|---|
| Melting Point | 113 °C |
| Molecular Formula | C12H17NO5 |
| Molecular Weight | 255.267 |
| Flash Point | 123.5ºC |
| Exact Mass | 255.110672 |
| PSA | 107.72000 |
| LogP | 1.59380 |
| Vapour Pressure | 0.0022mmHg at 25°C |
| InChIKey | IKMNOGHPKNFPTK-UHFFFAOYSA-N |
| SMILES | CCc1nc(C)ccc1O.O=C(O)CCC(=O)O |
| HS Code | 2933399090 |
|---|
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 3-hydroxy-6-methyl-2-ethylpyridine succinate |
| 3-Pyridinol, 2-ethyl-6-methyl-, butanedioate (1:1) (salt) |
| butanedioic acid,2-ethyl-6-methylpyridin-3-ol |
| Succinic acid - 2-ethyl-6-methyl-3-pyridinol (1:1) |
| Mexidol succinate |