1-diethoxyphosphoryl-2-(4-methoxyphenyl)ethanamine
Modify Date: 2026-09-07 20:37:53
1-diethoxyphosphoryl-2-(4-methoxyphenyl)ethanamine structure
|
Common Name | 1-diethoxyphosphoryl-2-(4-methoxyphenyl)ethanamine | ||
|---|---|---|---|---|
| CAS Number | 127780-65-8 | Molecular Weight | 287.29200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H22NO4P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1-diethoxyphosphoryl-2-(4-methoxyphenyl)ethanamine |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C13H22NO4P |
|---|---|
| Molecular Weight | 287.29200 |
| Exact Mass | 287.12900 |
| PSA | 80.59000 |
| LogP | 3.48890 |
| InChIKey | RGASCRBLLYUYQE-UHFFFAOYSA-N |
| SMILES | CCOP(=O)(OCC)C(N)Cc1ccc(OC)cc1 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 4 | |
|---|---|
| DownStream 2 | |
CAS#:4693-91-8
CAS#:104-93-8
CAS#:2746-25-0
CAS#:104-01-8![Phosphonic acid,P-[1-amino-2-(4-hydroxyphenyl)ethyl] structure](https://image.chemsrc.com/caspic/310/16656-37-4.png)
CAS#:16656-37-4![[1-amino-2-(4-methoxyphenyl)ethyl]phosphonic acid structure](https://image.chemsrc.com/caspic/284/66794-14-7.png)
CAS#:66794-14-7This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the polar surface area (PSA) of 1-diethoxyphosphoryl-2-(4-methoxyphenyl)ethanamine? |
| A: Polar surface area (PSA) of 1-diethoxyphosphoryl-2-(4-methoxyphenyl)ethanamine is 80.59000. |
| Q: What is the Chinese name of 127780-65-8? |
| A: Chinese name of 127780-65-8 is 127780-65-8. |
| Q: What is the LogP of 1-diethoxyphosphoryl-2-(4-methoxyphenyl)ethanamine? |
| A: LogP of 1-diethoxyphosphoryl-2-(4-methoxyphenyl)ethanamine is 3.48890. |
| Q: What are the upstream materials of 1-diethoxyphosphoryl-2-(4-methoxyphenyl)ethanamine? |
| A: Related upstream materials(CAS) of 1-diethoxyphosphoryl-2-(4-methoxyphenyl)ethanamine: 4693-91-8;104-93-8;2746-25-0;104-01-8. |
| Q: What is the English name of 1-diethoxyphosphoryl-2-(4-methoxyphenyl)ethanamine? |
| A: The English name of 1-diethoxyphosphoryl-2-(4-methoxyphenyl)ethanamine is 1-diethoxyphosphoryl-2-(4-methoxyphenyl)ethanamine. |
| Q: What is the InChIKey of 1-diethoxyphosphoryl-2-(4-methoxyphenyl)ethanamine? |
| A: InChIKey of 1-diethoxyphosphoryl-2-(4-methoxyphenyl)ethanamine is RGASCRBLLYUYQE-UHFFFAOYSA-N. |
| Q: What is the molecular weight of 1-diethoxyphosphoryl-2-(4-methoxyphenyl)ethanamine? |
| A: Molecular weight of 1-diethoxyphosphoryl-2-(4-methoxyphenyl)ethanamine is 287.29200. |
| Q: What are the downstream products of 1-diethoxyphosphoryl-2-(4-methoxyphenyl)ethanamine? |
| A: Related downstream products(CAS) of 1-diethoxyphosphoryl-2-(4-methoxyphenyl)ethanamine: 16656-37-4;66794-14-7. |
| Q: What is the CAS number of 1-diethoxyphosphoryl-2-(4-methoxyphenyl)ethanamine? |
| A: CAS number of 1-diethoxyphosphoryl-2-(4-methoxyphenyl)ethanamine is 127780-65-8. |
| Q: What is the SMILES notation of 1-diethoxyphosphoryl-2-(4-methoxyphenyl)ethanamine? |
| A: SMILES notation of 1-diethoxyphosphoryl-2-(4-methoxyphenyl)ethanamine is CCOP(=O)(OCC)C(N)Cc1ccc(OC)cc1. |