4-Methoxy-2-(trifluoromethyl)benzoic acid structure
|
Common Name | 4-Methoxy-2-(trifluoromethyl)benzoic acid | ||
|---|---|---|---|---|
| CAS Number | 127817-85-0 | Molecular Weight | 220.145 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 274.8±40.0 °C at 760 mmHg | |
| Molecular Formula | C9H7F3O3 | Melting Point | 147-150°C | |
| MSDS | N/A | Flash Point | 120.0±27.3 °C | |
| Name | 4-Methoxy-2-(Trifluoromethyl)Benzoic Acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 274.8±40.0 °C at 760 mmHg |
| Melting Point | 147-150°C |
| Molecular Formula | C9H7F3O3 |
| Molecular Weight | 220.145 |
| Flash Point | 120.0±27.3 °C |
| Exact Mass | 220.034729 |
| PSA | 46.53000 |
| LogP | 3.42 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
| Index of Refraction | 1.474 |
| InChIKey | MLCRFQSWSHKLDP-UHFFFAOYSA-N |
| SMILES | COc1ccc(C(=O)O)c(C(F)(F)F)c1 |
| Storage condition | 2~8°C |
| Hazard Codes | Xi:Irritant; |
|---|---|
| HS Code | 2918990090 |
|
~%
4-Methoxy-2-(tr... CAS#:127817-85-0 |
| Literature: US5183934 A1, ; |
|
~%
4-Methoxy-2-(tr... CAS#:127817-85-0 |
| Literature: Archiv der Pharmazie, , vol. 323, # 2 p. 73 - 78 |
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| QVR DO1 BXFFF |
| 4-Methoxy-2-(trifluoromethyl)benzoic acid |
| 2-(Trifluoromethyl)-p-anisic acid |
| Benzoic acid, 4-methoxy-2-(trifluoromethyl)- |
| α,α,α-Trifluoro-4-methoxy-o-toluic acid |
| MFCD01091013 |