6-Bromo-3-methoxy-2-nitrobenzoic acid structure
|
Common Name | 6-Bromo-3-methoxy-2-nitrobenzoic acid | ||
|---|---|---|---|---|
| CAS Number | 127971-97-5 | Molecular Weight | 276.041 | |
| Density | 1.8±0.1 g/cm3 | Boiling Point | 411.9±45.0 °C at 760 mmHg | |
| Molecular Formula | C8H6BrNO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 202.9±28.7 °C | |
| Name | 6-Bromo-3-methoxy-2-nitrobenzoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.8±0.1 g/cm3 |
|---|---|
| Boiling Point | 411.9±45.0 °C at 760 mmHg |
| Molecular Formula | C8H6BrNO5 |
| Molecular Weight | 276.041 |
| Flash Point | 202.9±28.7 °C |
| Exact Mass | 274.942932 |
| PSA | 92.35000 |
| LogP | 1.87 |
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
| Index of Refraction | 1.620 |
| InChIKey | GDQNQIOGEJXLHT-UHFFFAOYSA-N |
| SMILES | COc1ccc(Br)c(C(=O)O)c1[N+](=O)[O-] |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2918990090 |
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 6-Bromo-3-methoxy-2-nitrobenzoic acid |
| Benzoic acid, 6-bromo-3-methoxy-2-nitro- |
| Pyridine,6-bromo-3-methoxy-2-methyl |