3-O-methyl 1-O-propan-2-yl 4-hydroxy-6-methyl-2-(2-nitrophenyl)benzene-1,3-dicarboxylate structure
|
Common Name | 3-O-methyl 1-O-propan-2-yl 4-hydroxy-6-methyl-2-(2-nitrophenyl)benzene-1,3-dicarboxylate | ||
|---|---|---|---|---|
| CAS Number | 127975-78-4 | Molecular Weight | 373.35700 | |
| Density | 1.285g/cm3 | Boiling Point | 523.5ºC at 760 mmHg | |
| Molecular Formula | C19H19NO7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 270.4ºC | |
| Name | 3-O-methyl 1-O-propan-2-yl 4-hydroxy-6-methyl-2-(2-nitrophenyl)benzene-1,3-dicarboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.285g/cm3 |
|---|---|
| Boiling Point | 523.5ºC at 760 mmHg |
| Molecular Formula | C19H19NO7 |
| Molecular Weight | 373.35700 |
| Flash Point | 270.4ºC |
| Exact Mass | 373.11600 |
| PSA | 118.65000 |
| LogP | 4.15080 |
| Vapour Pressure | 1.41E-11mmHg at 25°C |
| Index of Refraction | 1.581 |
| InChIKey | XSAOKGZBHYQDNI-UHFFFAOYSA-N |
| SMILES | COC(=O)c1c(O)cc(C)c(C(=O)OC(C)C)c1-c1ccccc1[N+](=O)[O-] |
|
~35%
3-O-methyl 1-O-... CAS#:127975-78-4 |
| Literature: Take; Okumura; Takimoto; Kato; Ohtsuka; Shiokawa Chemical and Pharmaceutical Bulletin, 1991 , vol. 39, # 11 p. 2915 - 2923 |
| 6-(1-Methylethyl) 2-methyl 3-hydroxy-5-methyl-2'-nitro-(1,1'-biphenyl)-2,6-dicarboxylate |
| [1,1'-Biphenyl]-2,6-dicarboxylicacid,3-hydroxy-5-methyl-2'-nitro-,2-methyl 6-(1-methylethyl) ester |