9,10-Anthracenedione,1-amino-2-bromo-4-[(4-methylphenyl)amino]- structure
|
Common Name | 9,10-Anthracenedione,1-amino-2-bromo-4-[(4-methylphenyl)amino]- | ||
|---|---|---|---|---|
| CAS Number | 128-83-6 | Molecular Weight | 407.26000 | |
| Density | 1.567g/cm3 | Boiling Point | 595.2ºC at 760mmHg | |
| Molecular Formula | C21H15BrN2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 313.8ºC | |
| Name | 1-amino-2-bromo-4-(4-methylanilino)anthracene-9,10-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.567g/cm3 |
|---|---|
| Boiling Point | 595.2ºC at 760mmHg |
| Molecular Formula | C21H15BrN2O2 |
| Molecular Weight | 407.26000 |
| Flash Point | 313.8ºC |
| Exact Mass | 406.03200 |
| PSA | 72.19000 |
| LogP | 5.51290 |
| Vapour Pressure | 3.9E-14mmHg at 25°C |
| Index of Refraction | 1.739 |
| InChIKey | SPDRRRCQUXHHLH-UHFFFAOYSA-N |
| SMILES | Cc1ccc(Nc2cc(Br)c(N)c3c2C(=O)c2ccccc2C3=O)cc1 |
| HS Code | 2922399090 |
|---|
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| HS Code | 2922399090 |
|---|---|
| Summary | 2922399090 other amino-aldehydes, amino-ketones and amino-quinones, other than those containing more than one kind of oxygen function; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| Blue anthraquinone dye B/M |
| Solvent Blue 12 |
| 1-amino-2-bromo-4-(p-toluidino)-9,10-anthraquinone |
| EINECS 204-911-6 |
| 1-Amino-2-brom-4-p-toluidino-anthrachinon |
| 1-amino-2-bromo-4-(4-methylphenyl)-amino-9,10-anthraquinone |
| Ahcoquinone Sky Blue B Base |
| Anthraquinone Blue SKY Base |
| Toyo Oriental Oil Black K |
| 4-(p-toluidino)-1-amino-2-bromoanthracene-9,10-dione |
| Waxoline Blue BA |
| Sky Blue base |
| 1-amino-2-bromo-4-[(4-methylphenyl)amino]-9,10-anthracenedione |
| 1-amino-2-bromo-4-p-toluidino-anthraquinone |
| 1-Amino-2-brom-4-(p-tolylamino)-anthrachinon |
| C.I. Solvent Blue 12 |
| Alizarine Blue GRL Base |