1-amino-9,10-dihydro-9,10-dioxo-4-p-toluidinoanthracene-2-sulphonic acid structure
|
Common Name | 1-amino-9,10-dihydro-9,10-dioxo-4-p-toluidinoanthracene-2-sulphonic acid | ||
|---|---|---|---|---|
| CAS Number | 25912-94-1 | Molecular Weight | 408.42700 | |
| Density | 1.532g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C21H16N2O5S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-amino-4-(4-methylanilino)-9,10-dioxoanthracene-2-sulfonic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.532g/cm3 |
|---|---|
| Molecular Formula | C21H16N2O5S |
| Molecular Weight | 408.42700 |
| Exact Mass | 408.07800 |
| PSA | 134.94000 |
| LogP | 5.07790 |
| Index of Refraction | 1.725 |
| InChIKey | BSXYUOSITLGJAD-UHFFFAOYSA-N |
| SMILES | Cc1ccc(Nc2cc(S(=O)(=O)O)c(N)c3c2C(=O)c2ccccc2C3=O)cc1 |
| HS Code | 2922399090 |
|---|
|
~%
1-amino-9,10-di... CAS#:25912-94-1 |
| Literature: Agfa Patent: DE288665 ; Fortschr. Teerfarbenfabr. Verw. Industriezweige, vol. 12, p. 454 |
|
~%
1-amino-9,10-di... CAS#:25912-94-1 |
| Literature: Bayer and Co. Patent: DE288878 ; Fortschr. Teerfarbenfabr. Verw. Industriezweige, vol. 12, p. 453 |
|
~%
1-amino-9,10-di... CAS#:25912-94-1 |
| Literature: Bayer and Co. Patent: DE288878 ; Fortschr. Teerfarbenfabr. Verw. Industriezweige, vol. 12, p. 453 |
| Precursor 4 | |
|---|---|
| DownStream 0 | |
| HS Code | 2922399090 |
|---|---|
| Summary | 2922399090 other amino-aldehydes, amino-ketones and amino-quinones, other than those containing more than one kind of oxygen function; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 1-Amino-4-p-toluidino-anthrachinon-sulfonsaeure-(2) |
| 2-anthracenesulfonic acid,1-amino-9,10-dihydro-4-[(4-methylphenyl)amino]-9,10-dioxo |
| EINECS 247-339-2 |
| 1-amino-9,10-dioxo-4-p-toluidino-9,10-dihydro-anthracene-2-sulfonic acid |
| 1-Amino-9,10-dioxo-4-p-toluidino-9,10-dihydro-anthracen-2-sulfonsaeure |
| 1-Amino-9,10-dihydro-9,10-dioxo-4-p-toluidinoanthracene-2-sulphonic acid |