ethyl 5-(trifluoromethyl)picolinate structure
|
Common Name | ethyl 5-(trifluoromethyl)picolinate | ||
|---|---|---|---|---|
| CAS Number | 128072-94-6 | Molecular Weight | 219.161 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 264.7±40.0 °C at 760 mmHg | |
| Molecular Formula | C9H8F3NO2 | Melting Point | 45-48ºC | |
| MSDS | Chinese USA | Flash Point | 113.9±27.3 °C | |
| Symbol |
GHS06 |
Signal Word | Danger | |
| Name | ethyl 5-(trifluoromethyl)pyridine-2-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 264.7±40.0 °C at 760 mmHg |
| Melting Point | 45-48ºC |
| Molecular Formula | C9H8F3NO2 |
| Molecular Weight | 219.161 |
| Flash Point | 113.9±27.3 °C |
| Exact Mass | 219.050720 |
| PSA | 39.19000 |
| LogP | 2.40 |
| Vapour Pressure | 0.0±0.5 mmHg at 25°C |
| Index of Refraction | 1.449 |
| InChIKey | KCMOTZFSBYHKCI-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1ccc(C(F)(F)F)cn1 |
| Symbol |
GHS06 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H301-H315-H319-H335 |
| Precautionary Statements | P261-P301 + P310-P305 + P351 + P338 |
| Hazard Codes | Xn |
| Risk Phrases | 22-36/37/38 |
| Safety Phrases | 26 |
| RIDADR | UN 2811 6.1 / PGIII |
| HS Code | 2933399090 |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2-Pyridinecarboxylic acid, 5-(trifluoromethyl)-, ethyl ester |
| Ethyl 5-(trifluoromethyl)pyridine-2-carboxylate |
| Ethyl 5-(trifluoromethyl)-2-pyridinecarboxylate |
| ethyl 5-(trifluoromethyl)picolinate |
| 2-Pyridinecarboxylic acid,5-(trifluoromethyl)-,ethyl ester |
| 5-(Trifluoromethyl)-2-pyridinecarboxylic acid ethyl ester |