2,6-Bis[|4R|-4-phenyl-2-oxazolinyl]pyridine structure
|
Common Name | 2,6-Bis[|4R|-4-phenyl-2-oxazolinyl]pyridine | ||
|---|---|---|---|---|
| CAS Number | 128249-70-7 | Molecular Weight | 369.416 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 600.4±55.0 °C at 760 mmHg | |
| Molecular Formula | C23H19N3O2 | Melting Point | 171-175ºC | |
| MSDS | Chinese USA | Flash Point | 316.9±31.5 °C | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 2,6-Bis[(4R)-4-phenyl-2-oxazolinyl]pyridine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 600.4±55.0 °C at 760 mmHg |
| Melting Point | 171-175ºC |
| Molecular Formula | C23H19N3O2 |
| Molecular Weight | 369.416 |
| Flash Point | 316.9±31.5 °C |
| Exact Mass | 369.147736 |
| PSA | 56.07000 |
| LogP | 3.43 |
| Vapour Pressure | 0.0±1.6 mmHg at 25°C |
| Index of Refraction | 1.674 |
| InChIKey | HLHBIMJNCKZZQO-SFTDATJTSA-N |
| SMILES | c1ccc(C2COC(c3cccc(C4=NC(c5ccccc5)CO4)n3)=N2)cc1 |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi:Irritant; |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S36/37/39 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
|
~70%
2,6-Bis[|4R|-4-... CAS#:128249-70-7 |
| Literature: Kim, Hae-Jo; Asif, Riaz; Chung, Doo Soo; Hong, Jong-In Tetrahedron Letters, 2003 , vol. 44, # 23 p. 4335 - 4338 |
|
~63%
2,6-Bis[|4R|-4-... CAS#:128249-70-7 |
| Literature: Davies, Ian W.; Gerena, Linda; Lu, Nu; Larsen, Robert D.; Reider, Paul J. Journal of Organic Chemistry, 1996 , vol. 61, # 26 p. 9629 - 9630 |
|
~45%
2,6-Bis[|4R|-4-... CAS#:128249-70-7 |
| Literature: Takahashi, Shogo; Togo, Hideo Synthesis, 2009 , # 14 art. no. F03509SS, p. 2329 - 2332 |
|
~%
2,6-Bis[|4R|-4-... CAS#:128249-70-7 |
| Literature: Tetrahedron, , vol. 60, # 46 SPEC. ISS. p. 10515 - 10520 |
|
~%
2,6-Bis[|4R|-4-... CAS#:128249-70-7 |
| Literature: Tetrahedron, , vol. 60, # 46 SPEC. ISS. p. 10515 - 10520 |
|
~%
2,6-Bis[|4R|-4-... CAS#:128249-70-7 |
| Literature: Tetrahedron Letters, , vol. 44, # 23 p. 4335 - 4338 |
| 2,6-Bis((R)-4-phenyl-4,5-dihydrooxazol-2-yl)pyridine |
| (R,R)-2,2'-(2,6-Pyridinediyl)bis(4-phenyl-2-oxazoline) |
| Pyridine, 2,6-bis[(4S)-4,5-dihydro-4-phenyl-2-oxazolyl]- |
| (4R)-4-phenyl-2-[6-[(4R)-4-phenyl-4,5-dihydro-1,3-oxazol-2-yl]pyridin-2-yl]-4,5-dihydro-1,3-oxazole |
| (R,R)-2,6-Bis(4-phenyl-2-oxazolin-2-yl)pyridine |
| 2,6-Bis[(4R)-phenyl-2-(oxazolin-2-yl)]pyridine |
| (R,R)-2,6-Bis(4,5-dihydro-4-phenyl-2-oxazolyl)pyridine |
| 2,6-Bis[4R-4-phenyl-2-oxazolinyl]pyridine |
| 2,6-Bis[(4S)-4-phenyl-4,5-dihydro-1,3-oxazol-2-yl]pyridine |
| (R,R)-2,6-Bis(4-phenyl-2-oxazolinyl)pyridine |
| MFCD01863585 |