2-(methylsulfonyl)-1-[3-(trifluoromethyl)phenyl]ethanone structure
|
Common Name | 2-(methylsulfonyl)-1-[3-(trifluoromethyl)phenyl]ethanone | ||
|---|---|---|---|---|
| CAS Number | 128306-96-7 | Molecular Weight | 266.23700 | |
| Density | 1.743g/cm3 | Boiling Point | 159.8ºC at 760 mmHg | |
| Molecular Formula | C10H9F3O3S | Melting Point | 92-94ºC | |
| MSDS | N/A | Flash Point | 50.4ºC | |
| Name | 2-methylsulfonyl-1-[3-(trifluoromethyl)phenyl]ethanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.743g/cm3 |
|---|---|
| Boiling Point | 159.8ºC at 760 mmHg |
| Melting Point | 92-94ºC |
| Molecular Formula | C10H9F3O3S |
| Molecular Weight | 266.23700 |
| Flash Point | 50.4ºC |
| Exact Mass | 266.02200 |
| PSA | 59.59000 |
| LogP | 3.01350 |
| Vapour Pressure | 3.2mmHg at 25°C |
| Index of Refraction | 1.321 |
| InChIKey | DKOAKSYPFZFHMT-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)CC(=O)c1cccc(C(F)(F)F)c1 |
| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| MFCD00665597 |