Trimethyl(1,1':3',1''-terphenyl-5'-yl)silane structure
|
Common Name | Trimethyl(1,1':3',1''-terphenyl-5'-yl)silane | ||
|---|---|---|---|---|
| CAS Number | 128388-53-4 | Molecular Weight | 302.485 | |
| Density | 1.0±0.1 g/cm3 | Boiling Point | 398.6±31.0 °C at 760 mmHg | |
| Molecular Formula | C21H22Si | Melting Point | 81ºC | |
| MSDS | N/A | Flash Point | 181.3±18.4 °C | |
| Name | Trimethyl(m-terphenyl-5'-yl)silane |
|---|---|
| Synonym | More Synonyms |
| Density | 1.0±0.1 g/cm3 |
|---|---|
| Boiling Point | 398.6±31.0 °C at 760 mmHg |
| Melting Point | 81ºC |
| Molecular Formula | C21H22Si |
| Molecular Weight | 302.485 |
| Flash Point | 181.3±18.4 °C |
| Exact Mass | 302.149078 |
| LogP | 8.52 |
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
| Index of Refraction | 1.587 |
| InChIKey | GCYRLUSIWVFXEZ-UHFFFAOYSA-N |
| SMILES | C[Si](C)(C)c1cc(-c2ccccc2)cc(-c2ccccc2)c1 |
|
~86%
Trimethyl(1,1':... CAS#:128388-53-4 |
| Literature: Miller, Timothy M.; Neenan, Thomas X.; Zayas, Roberto; Bair, Harvey E. Journal of the American Chemical Society, 1992 , vol. 114, # 3 p. 1018 - 1025 |
|
~%
Trimethyl(1,1':... CAS#:128388-53-4 |
| Literature: Journal of Organic Chemistry, , vol. 66, # 7 p. 2358 - 2367 |
| (3,5-diphenylphenyl)-trimethylsilane |
| 3,5-Diphenyl-1-trimethylsilylbenzene |
| Silane, trimethyl([1,1':3',1''-terphenyl]-5'-yl)- |
| (M-Terphenyl-5'-yl)triMethylsilane |
| Trimethyl(1,1':3',1''-terphenyl-5'-yl)silane |
| 1,1':3',1''-Terphenyl, 5'-(trimethylsilyl)- |