hydroxyethyl beta-cyclodextrin structure
|
Common Name | hydroxyethyl beta-cyclodextrin | ||
|---|---|---|---|---|
| CAS Number | 128446-32-2 | Molecular Weight | 1443.352 | |
| Density | 1.7±0.1 g/cm3 | Boiling Point | 1557.6±65.0 °C at 760 mmHg | |
| Molecular Formula | C56H98O42 | Melting Point | 260ºC (dec.)(lit.) | |
| MSDS | Chinese USA | Flash Point | 895.8±34.3 °C | |
Use of hydroxyethyl beta-cyclodextrinβ-Cyclodextrin, 2-hydroxyethyl ethers is a biochemical reagent. |
| Name | (2-Hydroxyethyl)-β-cyclodextrin |
|---|---|
| Synonym | More Synonyms |
| Description | β-Cyclodextrin, 2-hydroxyethyl ethers is a biochemical reagent. |
|---|---|
| Related Catalog |
| Density | 1.7±0.1 g/cm3 |
|---|---|
| Boiling Point | 1557.6±65.0 °C at 760 mmHg |
| Melting Point | 260ºC (dec.)(lit.) |
| Molecular Formula | C56H98O42 |
| Molecular Weight | 1443.352 |
| Flash Point | 895.8±34.3 °C |
| Exact Mass | 1442.553223 |
| PSA | 618.66000 |
| LogP | -0.12 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
| Index of Refraction | 1.641 |
| InChIKey | PCWPQSDFNIFUPO-VDQKLNDWSA-N |
| SMILES | OCCOC1C2OC(CO)C(OC3OC(CO)C(OC4OC(CO)C(OC5OC(CO)C(OC6OC(CO)C(OC7OC(CO)C(OC8OC(CO)C(O2)C(O)C8OCCO)C(O)C7OCCO)C(O)C6OCCO)C(O)C5OCCO)C(O)C4OCCO)C(O)C3OCCO)C1O |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| Hazard Codes | Xi |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| (1S,3R,5R,6S,8R,10R,11S,13R,15R,16S,18R,20R,21S,23R,25R,26S,28R,30R,31S,33R,35R,36R,37S,38R,39S,40R,41S,42R,43S,44R,45S,46R,47S,48R,49S)-37,39,41,43,45,47,49-Heptakis(2-hydroxyethoxy)-5,10,15,20,25,30 ;,35-heptakis(hydroxymethyl)-2,4,7,9,12,14,17,19,22,24,27,29,32,34-tetradecaoxaoctacyclo[31.2.2.2.2.2.2.2.2]nonatetracontane-36,38,40,42,44,46,48-heptol (non-pref
 erred name) |
| HYDROXYETHYL β-CYCLODEXTRIN |
| MFCD00074976 |