methyl 3-methoxy-4-methyl-2-nitrobenzoate structure
|
Common Name | methyl 3-methoxy-4-methyl-2-nitrobenzoate | ||
|---|---|---|---|---|
| CAS Number | 128450-32-8 | Molecular Weight | 225.19800 | |
| Density | 1.255g/cm3 | Boiling Point | 343.188ºC at 760 mmHg | |
| Molecular Formula | C10H11NO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 154.531ºC | |
| Name | methyl 3-methoxy-4-methyl-2-nitrobenzoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.255g/cm3 |
|---|---|
| Boiling Point | 343.188ºC at 760 mmHg |
| Molecular Formula | C10H11NO5 |
| Molecular Weight | 225.19800 |
| Flash Point | 154.531ºC |
| Exact Mass | 225.06400 |
| PSA | 81.35000 |
| LogP | 2.22160 |
| Vapour Pressure | 0mmHg at 25°C |
| Index of Refraction | 1.537 |
| InChIKey | QAXKCCPPMGTAHL-UHFFFAOYSA-N |
| SMILES | COC(=O)c1ccc(C)c(OC)c1[N+](=O)[O-] |
| HS Code | 2918990090 |
|---|
|
~92%
methyl 3-methox... CAS#:128450-32-8 |
| Literature: PFIZER PRODUCTS INC. Patent: WO2007/125405 A2, 2007 ; Location in patent: Page/Page column 27; 87 ; WO 2007/125405 A2 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 2-Nitro-3-methoxy-4-methyl-benzoesaeure-methylester |