3-HYDROXY-4-METHYL-2-NITROBENZOIC ACID structure
|
Common Name | 3-HYDROXY-4-METHYL-2-NITROBENZOIC ACID | ||
|---|---|---|---|---|
| CAS Number | 6946-15-2 | Molecular Weight | 197.14500 | |
| Density | 1.534g/cm3 | Boiling Point | 379.7ºC at 760 mmHg | |
| Molecular Formula | C8H7NO5 | Melting Point | 185-187ºC(lit.) | |
| MSDS | Chinese USA | Flash Point | 171.1ºC | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 3-hydroxy-4-methyl-2-nitrobenzoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.534g/cm3 |
|---|---|
| Boiling Point | 379.7ºC at 760 mmHg |
| Melting Point | 185-187ºC(lit.) |
| Molecular Formula | C8H7NO5 |
| Molecular Weight | 197.14500 |
| Flash Point | 171.1ºC |
| Exact Mass | 197.03200 |
| PSA | 103.35000 |
| LogP | 1.83020 |
| Index of Refraction | 1.642 |
| InChIKey | HEKGHQKEERXLOI-UHFFFAOYSA-N |
| SMILES | Cc1ccc(C(=O)O)c([N+](=O)[O-])c1O |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi |
| Risk Phrases | 36/37/38 |
| Safety Phrases | S26-S37-S39 |
| RIDADR | NONH for all modes of transport |
| HS Code | 2918290000 |
|
~96%
3-HYDROXY-4-MET... CAS#:6946-15-2 |
| Literature: PFIZER PRODUCTS INC. Patent: WO2007/125405 A2, 2007 ; Location in patent: Page/Page column 27; 87 ; WO 2007/125405 A2 |
|
~%
3-HYDROXY-4-MET... CAS#:6946-15-2 |
| Literature: Chemische Berichte, , vol. 91, p. 1242,1263 Journal of the Chemical Society, , p. 3646 |
|
~%
3-HYDROXY-4-MET... CAS#:6946-15-2 |
| Literature: Journal of the Chemical Society, , p. 3646 |
| Precursor 3 | |
|---|---|
| DownStream 6 | |
| HS Code | 2918290000 |
|---|---|
| Summary | HS: 2918290000 other carboxylic acids with phenol function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) VAT:17.0% MFN tariff:6.5% General tariff:30.0% |
| MFCD00007106 |
| 3-Hydroxy-4-methyl-2-nitro-benzoic acid |
| 3-Hydroxy-4-methyl-2-nitro-benzoesaeure |
| 4-Methyl-3-hydroxy-2-nitrobenzoic acid |
| 2-nitro-3-hydroxy-4-methylbenzoic acid |
| 3-hydroxy-2-nitro-p-toluic acid |
| EINECS 230-105-9 |