Influenza Matrix Protein (61-72)
Modify Date: 2025-09-21 07:06:57
Influenza Matrix Protein (61-72) structure
|
Common Name | Influenza Matrix Protein (61-72) | ||
|---|---|---|---|---|
| CAS Number | 1286245-45-1 | Molecular Weight | 1352.60 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C63H97N15O18 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Influenza Matrix Protein (61-72)Influenza Matrix Protein (61-72) is a peptide fragment derived from matrix protein of influenza viruses, corresponds to amino acids 61-72. Influenza Matrix Protein (61-72) is a specific epitope which can induce CD4+ T-cell response[1]. |
| Name | Influenza Matrix Protein (61-72) |
|---|
| Description | Influenza Matrix Protein (61-72) is a peptide fragment derived from matrix protein of influenza viruses, corresponds to amino acids 61-72. Influenza Matrix Protein (61-72) is a specific epitope which can induce CD4+ T-cell response[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C63H97N15O18 |
|---|---|
| Molecular Weight | 1352.60 |
| InChIKey | GIVVBUTWDBWZQY-JKAUZBFUSA-N |
| SMILES | CC(C)CC(NC(=O)C(NC(=O)C(Cc1ccccc1)NC(=O)C(NC(=O)C(Cc1ccccc1)NC(=O)CN)C(C)C)C(C)O)C(=O)NC(C(=O)NC(C(=O)N1CCCC1C(=O)NC(CO)C(=O)NC(CCC(=O)O)C(=O)NC(CCCN=C(N)N)C(=O)O)C(C)C)C(C)O |