Sulfamonomethoxine-d4 structure
|
Common Name | Sulfamonomethoxine-d4 | ||
|---|---|---|---|---|
| CAS Number | 1286538-12-2 | Molecular Weight | 284.33 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H8D4N4O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Sulfamonomethoxine-d4Sulfamonomethoxine D4 is a deuterium labeled Sulfamonomethoxine. Sulfamonomethoxine is a long acting sulfonamide antibacterial agent, used in blood kinetic studies,and blocks the synthesis of folic acid by inhibiting synthetase of dihydropteroate[1]. |
| Name | Sulfamonomethoxine D4 |
|---|
| Description | Sulfamonomethoxine D4 is a deuterium labeled Sulfamonomethoxine. Sulfamonomethoxine is a long acting sulfonamide antibacterial agent, used in blood kinetic studies,and blocks the synthesis of folic acid by inhibiting synthetase of dihydropteroate[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C11H8D4N4O3S |
|---|---|
| Molecular Weight | 284.33 |
| InChIKey | WMPXPUYPYQKQCX-QFFDRWTDSA-N |
| SMILES | COc1cc(NS(=O)(=O)c2ccc(N)cc2)ncn1 |