Sulfamonomethoxine sodium structure
|
Common Name | Sulfamonomethoxine sodium | ||
|---|---|---|---|---|
| CAS Number | 38006-08-5 | Molecular Weight | 302.28 | |
| Density | N/A | Boiling Point | 513.2ºC at 760 mmHg | |
| Molecular Formula | C11H11N4NaO3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 264.2ºC | |
Use of Sulfamonomethoxine sodiumSulfamonomethoxine sodium is a long acting sulfonamide?antibacterial?agent, used in blood kinetic studies,and blocks the synthesis of folic acid by inhibiting synthetase of dihydropteroate[1]. |
| Name | Sulfamonomethoxine sodium |
|---|---|
| Synonym | More Synonyms |
| Description | Sulfamonomethoxine sodium is a long acting sulfonamide?antibacterial?agent, used in blood kinetic studies,and blocks the synthesis of folic acid by inhibiting synthetase of dihydropteroate[1]. |
|---|---|
| Related Catalog | |
| Target |
IC50: antibacterial[1] |
| References |
| Boiling Point | 513.2ºC at 760 mmHg |
|---|---|
| Molecular Formula | C11H11N4NaO3S |
| Molecular Weight | 302.28 |
| Flash Point | 264.2ºC |
| Exact Mass | 302.044952 |
| PSA | 106.79000 |
| LogP | 2.38900 |
| InChIKey | IZJAOWYNDLDRKM-UHFFFAOYSA-N |
| SMILES | COc1cc([N-]S(=O)(=O)c2ccc(N)cc2)ncn1.[Na+] |
| Hazard Codes | Xi |
|---|
| Benzenesulfonamide, 4-amino-N-(6-methoxy-4-pyrimidinyl)-, sodium salt (1:1) |
| Sodium [(4-aminophenyl)sulfonyl](6-methoxypyrimidin-4-yl)azanide |
| Sodium [(4-aminophenyl)sulfonyl](6-methoxy-4-pyrimidinyl)azanide |