9,10-Anthracenedione,1-chloro-8-nitro structure
|
Common Name | 9,10-Anthracenedione,1-chloro-8-nitro | ||
|---|---|---|---|---|
| CAS Number | 129-38-4 | Molecular Weight | 287.65500 | |
| Density | 1.573g/cm3 | Boiling Point | 508.5ºC at 760mmHg | |
| Molecular Formula | C14H6ClNO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 261.3ºC | |
| Name | 1-chloro-8-nitroanthracene-9,10-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.573g/cm3 |
|---|---|
| Boiling Point | 508.5ºC at 760mmHg |
| Molecular Formula | C14H6ClNO4 |
| Molecular Weight | 287.65500 |
| Flash Point | 261.3ºC |
| Exact Mass | 286.99900 |
| PSA | 79.96000 |
| LogP | 3.54680 |
| Vapour Pressure | 1.85E-10mmHg at 25°C |
| Index of Refraction | 1.692 |
| InChIKey | DPXBPDAJRIKYIA-UHFFFAOYSA-N |
| SMILES | O=C1c2cccc(Cl)c2C(=O)c2c1cccc2[N+](=O)[O-] |
|
~%
9,10-Anthracene... CAS#:129-38-4 |
| Literature: Eckert Chemische Berichte, 1927 , vol. 60, p. 1691 |
|
~%
9,10-Anthracene... CAS#:129-38-4 |
| Literature: Eckert Chemische Berichte, 1927 , vol. 60, p. 1691 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
|
Name: NCI human tumor cell line growth inhibition assay. Data for the IGROV1 Non-Small Cell...
Source: DTP/NCI
Target: N/A
External Id: IGROV1_OneDose
|
| 1,8-Chloronitroanthraquinone |
| 8-Chloro-1-nitroanthraquinone |
| 1-Chlor-8-nitro-anthrachinon |
| 9,1-chloro-8-nitro |
| 1-Nitro-8-chloroanthraquinone |
| 1-Chloro-8-nitroanthraquinone |
| 8-Chlor-1-nitro-anthrachinon |