9,10-Anthracenedione,1-amino-8-chloro- structure
|
Common Name | 9,10-Anthracenedione,1-amino-8-chloro- | ||
|---|---|---|---|---|
| CAS Number | 117-09-9 | Molecular Weight | 257.67200 | |
| Density | 1.486g/cm3 | Boiling Point | 500.9ºC at 760mmHg | |
| Molecular Formula | C14H8ClNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 256.7ºC | |
| Name | 1-amino-8-chloroanthracene-9,10-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.486g/cm3 |
|---|---|
| Boiling Point | 500.9ºC at 760mmHg |
| Molecular Formula | C14H8ClNO2 |
| Molecular Weight | 257.67200 |
| Flash Point | 256.7ºC |
| Exact Mass | 257.02400 |
| PSA | 60.16000 |
| LogP | 3.27880 |
| Vapour Pressure | 3.64E-10mmHg at 25°C |
| Index of Refraction | 1.711 |
| InChIKey | JMNNJCADZZBEOW-UHFFFAOYSA-N |
| SMILES | Nc1cccc2c1C(=O)c1c(Cl)cccc1C2=O |
|
~0%
9,10-Anthracene... CAS#:117-09-9 |
| Literature: US4179450 A1, ; |
|
~87%
9,10-Anthracene... CAS#:117-09-9 |
| Literature: Journal of Medicinal Chemistry, , vol. 44, # 12 p. 2004 - 2014 |
|
~%
9,10-Anthracene... CAS#:117-09-9 |
| Literature: DE549137 , ; Fortschr. Teerfarbenfabr. Verw. Industriezweige, vol. 19, p. 1945 |
|
~%
9,10-Anthracene... CAS#:117-09-9 |
| Literature: Synthetic Communications, , vol. 23, # 22 p. 3211 - 3222 |
|
~%
9,10-Anthracene... CAS#:117-09-9 |
| Literature: DE287756 ; Fortschr. Teerfarbenfabr. Verw. Industriezweige, vol. 12, p. 120 |
| Precursor 4 | |
|---|---|
| DownStream 5 | |
| 1-amino-8-chloro-9,10-anthracenedione |
| 9,1-amino-8-chloro |
| 8-chloro-1-aminoanthraquinone |
| 1-Amino-8-chlor-anthrachinon |
| Anthraquinone,1-amino-8-chloro |
| 1-Amino-8-chloroanthraquinone |