9,10-Anthracenedione,1-(butylamino)
9,10-Anthracenedione,1-(butylamino) structure
|
Common Name | 9,10-Anthracenedione,1-(butylamino) | ||
|---|---|---|---|---|
| CAS Number | 129-45-3 | Molecular Weight | 279.33300 | |
| Density | 1.224g/cm3 | Boiling Point | 485.5ºC at 760mmHg | |
| Molecular Formula | C18H17NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 183.3ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1-(butylamino)anthracene-9,10-dione |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.224g/cm3 |
|---|---|
| Boiling Point | 485.5ºC at 760mmHg |
| Molecular Formula | C18H17NO2 |
| Molecular Weight | 279.33300 |
| Flash Point | 183.3ºC |
| Exact Mass | 279.12600 |
| PSA | 46.17000 |
| LogP | 3.74700 |
| Vapour Pressure | 1.41E-09mmHg at 25°C |
| Index of Refraction | 1.64 |
| InChIKey | AHOSCUOPPDQVDR-UHFFFAOYSA-N |
| SMILES | CCCCNc1cccc2c1C(=O)c1ccccc1C2=O |
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| HS Code | 2922399090 |
|---|
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 10 | |
|---|---|
| DownStream 0 | |
CAS#:109-65-9
CAS#:82-45-1
CAS#:82-34-8
CAS#:542-69-8
CAS#:123-72-8
CAS#:109-73-9
CAS#:632-83-7
CAS#:82-44-0
CAS#:64-19-7
CAS#:81-62-9This table shows customs‑related data including HS‑code, tariff and regulatory conditions for import and export.
| HS Code | 2922399090 |
|---|---|
| Summary | 2922399090 other amino-aldehydes, amino-ketones and amino-quinones, other than those containing more than one kind of oxygen function; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 9,1-(butylamino) |
| 1-(N-Butylamino)-anthrachinon |
| EINECS 204-948-8 |
| 1-Butylamino-anthrachinon |
| 1-butylaminoanthraquinone |
| Anthraquinone,1-(butylamino) |
| 1-n-Butylaminoanthraquinone |
| N-n-butylamino-1-anthraquinone |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of 1-(butylamino)anthracene-9,10-dione? |
| A: Molecular weight of 1-(butylamino)anthracene-9,10-dione is 279.33300. |
| Q: What is the molecular formula of 1-(butylamino)anthracene-9,10-dione? |
| A: Molecular formula of 1-(butylamino)anthracene-9,10-dione is C18H17NO2. |
| Q: What is the LogP of 1-(butylamino)anthracene-9,10-dione? |
| A: LogP of 1-(butylamino)anthracene-9,10-dione is 3.74700. |
| Q: What English synonyms does 1-(butylamino)anthracene-9,10-dione have? |
| A: English synonyms of 1-(butylamino)anthracene-9,10-dione: 9,1-(butylamino), 1-(N-Butylamino)-anthrachinon, EINECS 204-948-8, 1-Butylamino-anthrachinon, 1-butylaminoanthraquinone, Anthraquinone,1-(butylamino), 1-n-Butylaminoanthraquinone, N-n-butylamino-1-anthraquinone. |
| Q: What is the InChIKey of 1-(butylamino)anthracene-9,10-dione? |
| A: InChIKey of 1-(butylamino)anthracene-9,10-dione is AHOSCUOPPDQVDR-UHFFFAOYSA-N. |
| Q: What is the boiling point of 1-(butylamino)anthracene-9,10-dione? |
| A: Boiling point of 1-(butylamino)anthracene-9,10-dione is 485.5ºC at 760mmHg. |
| Q: What is the SMILES notation of 1-(butylamino)anthracene-9,10-dione? |
| A: SMILES notation of 1-(butylamino)anthracene-9,10-dione is CCCCNc1cccc2c1C(=O)c1ccccc1C2=O. |
| Q: What is the English name of 1-(butylamino)anthracene-9,10-dione? |
| A: The English name of 1-(butylamino)anthracene-9,10-dione is 1-(butylamino)anthracene-9,10-dione. |
| Q: What is the CAS number of 1-(butylamino)anthracene-9,10-dione? |
| A: CAS number of 1-(butylamino)anthracene-9,10-dione is 129-45-3. |
| Q: What is the Chinese name of 129-45-3? |
| A: Chinese name of 129-45-3 is 129-45-3. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |