1-Bromo-9,10-anthraquinone structure
|
Common Name | 1-Bromo-9,10-anthraquinone | ||
|---|---|---|---|---|
| CAS Number | 632-83-7 | Molecular Weight | 287.108 | |
| Density | 1.6±0.1 g/cm3 | Boiling Point | 444.9±34.0 °C at 760 mmHg | |
| Molecular Formula | C14H7BrO2 | Melting Point | 191ºC | |
| MSDS | N/A | Flash Point | 161.0±12.2 °C | |
| Name | 1-Bromoanthraquinone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.6±0.1 g/cm3 |
|---|---|
| Boiling Point | 444.9±34.0 °C at 760 mmHg |
| Melting Point | 191ºC |
| Molecular Formula | C14H7BrO2 |
| Molecular Weight | 287.108 |
| Flash Point | 161.0±12.2 °C |
| Exact Mass | 285.962921 |
| PSA | 34.14000 |
| LogP | 4.16 |
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |
| Index of Refraction | 1.682 |
| InChIKey | CXTPIHZYOGDSLV-UHFFFAOYSA-N |
| SMILES | O=C1c2ccccc2C(=O)c2c(Br)cccc21 |
| Precursor 10 | |
|---|---|
| DownStream 10 | |
|
Name: Inhibition of PDK4 (unknown origin) at 1 uM relative to control
Source: ChEMBL
Target: [Pyruvate dehydrogenase (acetyl-transferring)] kinase isozyme 4, mitochondrial
External Id: CHEMBL4333047
|
| L C666 BV IVJ DE |
| 1-Bromo-9,10-anthracenedione |
| 1-bromoanthracene-9,10-dione |
| 1-Bromo-9,10-anthraquinone |