8-Amino-1,6-naphthalenedisulfonic acid structure
|
Common Name | 8-Amino-1,6-naphthalenedisulfonic acid | ||
|---|---|---|---|---|
| CAS Number | 129-91-9 | Molecular Weight | 303.312 | |
| Density | 1.8±0.1 g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C10H9NO6S2 | Melting Point | 213-218°C | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 8-Aminonaphthalene-1,6-disulfonic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.8±0.1 g/cm3 |
|---|---|
| Melting Point | 213-218°C |
| Molecular Formula | C10H9NO6S2 |
| Molecular Weight | 303.312 |
| Exact Mass | 302.987122 |
| PSA | 151.52000 |
| LogP | -1.57 |
| Index of Refraction | 1.733 |
| InChIKey | YDEOXZHCPCPPJG-UHFFFAOYSA-N |
| SMILES | Nc1cc(S(=O)(=O)O)cc2cccc(S(=O)(=O)O)c12 |
| Hazard Codes | T |
|---|---|
| Risk Phrases | R25:Toxic if swallowed. R36/37/38:Irritating to eyes, respiratory system and skin . |
| Safety Phrases | S26-S36/37/39 |
| HS Code | 2921499090 |
|
~%
8-Amino-1,6-nap... CAS#:129-91-9 |
|
Literature: Grundlegende Operationen der Farbenchemie, 5. Aufl. |
| HS Code | 2921499090 |
|---|---|
| Summary | 2921499090 other aromatic monoamines and their derivatives; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 8-Amino-naphthalin-1,6-disulfonsaeure |
| 1,6-Naphthalenedisulfonic acid, 8-amino- |
| MFCD00021548 |
| 8-Aminonaphthalene-1,6-disulfonic acid |
| 1-Amino-3,8-disulfonaphthalene |
| 1-Naphthylamine-3,8-disulfonic acid |
| EINECS 204-969-2 |
| 1-amino-3,8-naphthalenedisulfonic acid |
| 1,8-amino |
| Aminoepsilon acid |
| 8-Aminonaphthalene-1,6-disulphonic acid |
| 8-Amino-1,6-naphthalenedisulfonic acid |
| 8-amino-naphthalene-1,6-disulfonic acid |