DL-3-Amino-3-(2-naphthyl)propionic acid structure
|
Common Name | DL-3-Amino-3-(2-naphthyl)propionic acid | ||
|---|---|---|---|---|
| CAS Number | 129042-57-5 | Molecular Weight | 215.248 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 412.3±33.0 °C at 760 mmHg | |
| Molecular Formula | C13H13NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 203.2±25.4 °C | |
| Name | DL-3-Amino-3-(2-Naphthyl)Propionic Acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 412.3±33.0 °C at 760 mmHg |
| Molecular Formula | C13H13NO2 |
| Molecular Weight | 215.248 |
| Flash Point | 203.2±25.4 °C |
| Exact Mass | 215.094635 |
| PSA | 63.32000 |
| LogP | 2.14 |
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
| Index of Refraction | 1.659 |
| InChIKey | JASNXOXPNZWQRV-UHFFFAOYSA-N |
| SMILES | NC(CC(=O)O)c1ccc2ccccc2c1 |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2922499990 |
|
~65%
DL-3-Amino-3-(2... CAS#:129042-57-5 |
| Literature: Tse, Man Kin; Bhor, Santosh; Klawonn, Markus; Anilkumar, Gopinathan; Jiao, Haijun; Doebler, Christian; Spannenberg, Anke; Magerlein, Wolfgang; Hugl, Herbert; Beller, Matthias Chemistry - A European Journal, 2006 , vol. 12, # 7 p. 1855 - 1874 |
|
~%
DL-3-Amino-3-(2... CAS#:129042-57-5 |
| Literature: Chemische Berichte, , vol. 86, p. 529,532 |
| HS Code | 2922499990 |
|---|---|
| Summary | HS:2922499990 other amino-acids, other than those containing more than one kind of oxygen function, and their esters; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:6.5% General tariff:30.0% |
| 2-Naphthalenepropanoic acid, β-amino- |
| 3-Amino-3-(2-naphthyl)propanoic acid |
| 3-Amino-3-naphthalen-2-yl-propionic acid |
| 3-amino-3-naphthalen-2-ylpropanoic acid |
| 3-Amino-3-(2-naphthyl)propionic acid |
| DL-3-Amino-3-(2-naphthyl)propionic acid |