Viniferin
Modify Date: 2025-09-18 11:21:17
Viniferin structure
|
Common Name | Viniferin | ||
|---|---|---|---|---|
| CAS Number | 129170-22-5 | Molecular Weight | 454.47 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | 694.8±55.0 °C at 760 mmHg | |
| Molecular Formula | C28H22O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 374.0±31.5 °C | |
Use of ViniferinDescription Natural product derived from plant source.Viniferin has been used to study its effect on melanin production in melanocyte cultures. |
| Name | Viniferin |
|---|---|
| Synonym | More Synonyms |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Boiling Point | 694.8±55.0 °C at 760 mmHg |
| Molecular Formula | C28H22O6 |
| Molecular Weight | 454.47 |
| Flash Point | 374.0±31.5 °C |
| Exact Mass | 454.141632 |
| LogP | 4.60 |
| Vapour Pressure | 0.0±2.3 mmHg at 25°C |
| Index of Refraction | 1.777 |
| InChIKey | FQWLMRXWKZGLFI-BQYFGGCBSA-N |
| SMILES | Oc1ccc(C=Cc2cc(O)cc3c2C(c2cc(O)cc(O)c2)C(c2ccc(O)cc2)O3)cc1 |
| (+)-ε-Viniferin |