Pierreione B structure
|
Common Name | Pierreione B | ||
|---|---|---|---|---|
| CAS Number | 1292766-21-2 | Molecular Weight | 452.50 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 647.8±55.0 °C at 760 mmHg | |
| Molecular Formula | C26H28O7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 218.5±25.0 °C | |
Use of Pierreione BPierreione B is a pyranoisoflavone, that can be isolated from the leaves and twigs of Antheroporum pierrei. Pierreione B demonstrates solid tumor selectivity with minimal cytotoxicity[1]. |
| Name | Pierreione B |
|---|---|
| Synonym | More Synonyms |
| Description | Pierreione B is a pyranoisoflavone, that can be isolated from the leaves and twigs of Antheroporum pierrei. Pierreione B demonstrates solid tumor selectivity with minimal cytotoxicity[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 647.8±55.0 °C at 760 mmHg |
| Molecular Formula | C26H28O7 |
| Molecular Weight | 452.50 |
| Flash Point | 218.5±25.0 °C |
| Exact Mass | 452.183502 |
| PSA | 98.36000 |
| LogP | 4.12 |
| Vapour Pressure | 0.0±2.0 mmHg at 25°C |
| Index of Refraction | 1.595 |
| InChIKey | RDXLWAJRBPKMPD-HSZRJFAPSA-N |
| SMILES | COc1cc(-c2coc3cc4c(cc3c2=O)C=CC(C)(C)O4)ccc1OCC(O)C(C)(C)O |
| Hazard Codes | Xi |
|---|
| 7-{4-[(2R)-2,3-Dihydroxy-3-methylbutoxy]-3-methoxyphenyl}-2,2-dimethyl-2H,6H-pyrano[3,2-g]chromen-6-one |
| 2H,6H-Benzo[1,2-b:5,4-b']dipyran-6-one, 7-[4-[(2R)-2,3-dihydroxy-3-methylbutoxy]-3-methoxyphenyl]-2,2-dimethyl- |