KRIBB3 structure
|
Common Name | KRIBB3 | ||
|---|---|---|---|---|
| CAS Number | 129414-88-6 | Molecular Weight | 325.35800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C19H19NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of KRIBB3KRIBB3 is an Hsp27 and microtubule inhibitor that inhibits migration and invasion of MDA-MB-231 cells in vitro in an Hsp27-dependent manner. |
| Name | 4-ethyl-3-methoxy-6-[4-(4-methoxyphenyl)-2H-1,2-oxazol-5-ylidene]cyclohexa-2,4-dien-1-one |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C19H19NO4 |
|---|---|
| Molecular Weight | 325.35800 |
| Exact Mass | 325.13100 |
| PSA | 64.46000 |
| LogP | 3.16450 |
| Index of Refraction | 1.61 |
| InChIKey | BNBHIGLOMVMJDB-UHFFFAOYSA-N |
| SMILES | CCc1cc(-c2oncc2-c2ccc(OC)cc2)c(O)cc1OC |
| KRIBB3 |