[1-(2-trimethylsilylethoxymethyl)imidazol-2-yl]methanol
![[1-(2-trimethylsilylethoxymethyl)imidazol-2-yl]methanol Structure](https://image.chemsrc.com/caspic/229/129486-90-4.png)
[1-(2-trimethylsilylethoxymethyl)imidazol-2-yl]methanol structure
|
Common Name | [1-(2-trimethylsilylethoxymethyl)imidazol-2-yl]methanol | ||
|---|---|---|---|---|
| CAS Number | 129486-90-4 | Molecular Weight | 228.36300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H20N2O2Si | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Summary: 1-(2-Trimethylsilylethoxymethyl)imidazol-2-yl]methanol, Chinese name 1-(2-三甲基硅乙氧甲基)咪唑-2-基)甲醇, CAS number 129486-90-4, molecular formula C10H20N2O2Si, molecular weight 228.36300. For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | [1-(2-trimethylsilylethoxymethyl)imidazol-2-yl]methanol |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C10H20N2O2Si |
|---|---|
| Molecular Weight | 228.36300 |
| Exact Mass | 228.12900 |
| PSA | 47.28000 |
| LogP | 1.68770 |
| InChIKey | ZQKHRAXLCGDJDL-UHFFFAOYSA-N |
| SMILES | C[Si](C)(C)CCOCn1ccnc1CO |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 3 | |
|---|---|
| DownStream 0 | |
CAS#:101226-42-0![1-[[2-(trimethylsilyl)ethoxy]methyl]-1H-imidazole Structure](https://image.chemsrc.com/caspic/237/101226-33-9.png)
CAS#:101226-33-9
CAS#:68-12-2This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of [1-(2-trimethylsilylethoxymethyl)imidazol-2-yl]methanol? |
| A: SMILES notation of [1-(2-trimethylsilylethoxymethyl)imidazol-2-yl]methanol is C[Si](C)(C)CCOCn1ccnc1CO. |
| Q: What is the molecular weight of [1-(2-trimethylsilylethoxymethyl)imidazol-2-yl]methanol? |
| A: Molecular weight of [1-(2-trimethylsilylethoxymethyl)imidazol-2-yl]methanol is 228.36300. |
| Q: What is the Chinese name of 129486-90-4? |
| A: Chinese name of 129486-90-4 is 129486-90-4. |
| Q: What is the polar surface area (PSA) of [1-(2-trimethylsilylethoxymethyl)imidazol-2-yl]methanol? |
| A: Polar surface area (PSA) of [1-(2-trimethylsilylethoxymethyl)imidazol-2-yl]methanol is 47.28000. |
| Q: What is the molecular formula of [1-(2-trimethylsilylethoxymethyl)imidazol-2-yl]methanol? |
| A: Molecular formula of [1-(2-trimethylsilylethoxymethyl)imidazol-2-yl]methanol is C10H20N2O2Si. |
| Q: What is the InChIKey of [1-(2-trimethylsilylethoxymethyl)imidazol-2-yl]methanol? |
| A: InChIKey of [1-(2-trimethylsilylethoxymethyl)imidazol-2-yl]methanol is ZQKHRAXLCGDJDL-UHFFFAOYSA-N. |
| Q: What are the upstream materials of [1-(2-trimethylsilylethoxymethyl)imidazol-2-yl]methanol? |
| A: Related upstream materials(CAS) of [1-(2-trimethylsilylethoxymethyl)imidazol-2-yl]methanol: 101226-42-0;101226-33-9;68-12-2. |
| Q: What is the LogP of [1-(2-trimethylsilylethoxymethyl)imidazol-2-yl]methanol? |
| A: LogP of [1-(2-trimethylsilylethoxymethyl)imidazol-2-yl]methanol is 1.68770. |
| Q: What is the English name of [1-(2-trimethylsilylethoxymethyl)imidazol-2-yl]methanol? |
| A: The English name of [1-(2-trimethylsilylethoxymethyl)imidazol-2-yl]methanol is [1-(2-trimethylsilylethoxymethyl)imidazol-2-yl]methanol. |
| Q: What is the CAS number of [1-(2-trimethylsilylethoxymethyl)imidazol-2-yl]methanol? |
| A: CAS number of [1-(2-trimethylsilylethoxymethyl)imidazol-2-yl]methanol is 129486-90-4. |