3,4-Diacetoxycinnamamide structure
|
Common Name | 3,4-Diacetoxycinnamamide | ||
|---|---|---|---|---|
| CAS Number | 129488-34-2 | Molecular Weight | 263.246 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 497.3±45.0 °C at 760 mmHg | |
| Molecular Formula | C13H13NO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 262.0±25.0 °C | |
| Name | 4-[(1E)-3-Amino-3-oxo-1-propen-1-yl]-1,2-phenylene diacetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 497.3±45.0 °C at 760 mmHg |
| Molecular Formula | C13H13NO5 |
| Molecular Weight | 263.246 |
| Flash Point | 262.0±25.0 °C |
| Exact Mass | 263.079376 |
| PSA | 95.69000 |
| LogP | -0.22 |
| Vapour Pressure | 0.0±1.3 mmHg at 25°C |
| Index of Refraction | 1.577 |
| InChIKey | DUWHMOBTGPUYEL-GQCTYLIASA-N |
| SMILES | CC(=O)Oc1ccc(C=CC(N)=O)cc1OC(C)=O |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2924299090 |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 4-[(1E)-3-Amino-3-oxo-1-propen-1-yl]-1,2-phenylene diacetate |