tert-butyl N-[(2S,3S,4R,5S)-3,4-dihydroxy-5-[(2-methylpropan-2-yl)oxycarbonylamino]-1,6-diphenylhexan-2-yl]carbamate structure
|
Common Name | tert-butyl N-[(2S,3S,4R,5S)-3,4-dihydroxy-5-[(2-methylpropan-2-yl)oxycarbonylamino]-1,6-diphenylhexan-2-yl]carbamate | ||
|---|---|---|---|---|
| CAS Number | 129491-65-2 | Molecular Weight | 500.62700 | |
| Density | 1.15g/cm3 | Boiling Point | 680.3ºC at 760mmHg | |
| Molecular Formula | C28H40N2O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 365.2ºC | |
| Name | tert-butyl N-[(2S,3S,4R,5S)-3,4-dihydroxy-5-[(2-methylpropan-2-yl)oxycarbonylamino]-1,6-diphenylhexan-2-yl]carbamate |
|---|
| Density | 1.15g/cm3 |
|---|---|
| Boiling Point | 680.3ºC at 760mmHg |
| Molecular Formula | C28H40N2O6 |
| Molecular Weight | 500.62700 |
| Flash Point | 365.2ºC |
| Exact Mass | 500.28900 |
| PSA | 124.10000 |
| LogP | 4.38900 |
| Vapour Pressure | 1.94E-19mmHg at 25°C |
| Index of Refraction | 1.55 |
| InChIKey | XEFORNHNQOHGSE-NEWJYFPISA-N |
| SMILES | CC(C)(C)OC(=O)NC(Cc1ccccc1)C(O)C(O)C(Cc1ccccc1)NC(=O)OC(C)(C)C |
|
Name: Inhibitory activity against recombinant HIV-1 Protease
Source: ChEMBL
Target: Pol polyprotein
External Id: CHEMBL769255
|
|
Name: The compound was tested for its affinity against HIV-1 protease
Source: ChEMBL
Target: Pol polyprotein
External Id: CHEMBL763099
|
|
Name: Binding affinity to HIV-1 protease
Source: ChEMBL
Target: Pol polyprotein
External Id: CHEMBL768260
|