N-Boc-L-phenylalaninal structure
|
Common Name | N-Boc-L-phenylalaninal | ||
|---|---|---|---|---|
| CAS Number | 72155-45-4 | Molecular Weight | 249.306 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 367.0±35.0 °C at 760 mmHg | |
| Molecular Formula | C14H19NO3 | Melting Point | 86-88 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | 175.8±25.9 °C | |
| Name | N-Boc-L-phenylalaninal |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 367.0±35.0 °C at 760 mmHg |
| Melting Point | 86-88 °C(lit.) |
| Molecular Formula | C14H19NO3 |
| Molecular Weight | 249.306 |
| Flash Point | 175.8±25.9 °C |
| Exact Mass | 249.136490 |
| PSA | 55.40000 |
| LogP | 3.16 |
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
| Index of Refraction | 1.509 |
| InChIKey | ZJTYRNPLVNMVPQ-LBPRGKRZSA-N |
| SMILES | CC(C)(C)OC(=O)NC(C=O)Cc1ccccc1 |
| Storage condition | -20°C |
| Hazard Codes | Xi |
|---|---|
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2924299090 |
| Precursor 10 | |
|---|---|
| DownStream 10 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|
Mordini, A. et al.
Tetrahedron Lett. 37 , 5209, (1996)
|
| Carbamic acid, N-(1-formyl-2-phenylethyl)-, 1,1-dimethylethyl ester |
| MFCD00143854 |
| N-tert-butyloxycarbonyl-2-amino-3-phenylpropionaldehyde |
| tert-butyl N-[(2S)-1-oxo-3-phenylpropan-2-yl]carbamate |
| 2-Methyl-2-propanyl [(2S)-1-oxo-3-phenyl-2-propanyl]carbamate |
| 2-Methyl-2-propanyl (1-oxo-3-phenyl-2-propanyl)carbamate |
| Carbamic acid, N-[(1S)-1-formyl-2-phenylethyl]-, 1,1-dimethylethyl ester |
| tert-Butyl [(2S)-1-oxo-3-phenylpropan-2-yl]carbamate |
| N-Boc-2-amino-3-phenylpropionaldehyde |
| N-tert-butoxycarbonylphenylalaninal |