1-Benzyl 3-methyl piperazine-1,3-dicarboxylate structure
|
Common Name | 1-Benzyl 3-methyl piperazine-1,3-dicarboxylate | ||
|---|---|---|---|---|
| CAS Number | 129799-11-7 | Molecular Weight | 278.304 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 406.5±45.0 °C at 760 mmHg | |
| Molecular Formula | C14H18N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 199.7±28.7 °C | |
| Name | 4-Cbz-Piperazine-2-Carboxylate Methyl Ester |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 406.5±45.0 °C at 760 mmHg |
| Molecular Formula | C14H18N2O4 |
| Molecular Weight | 278.304 |
| Flash Point | 199.7±28.7 °C |
| Exact Mass | 278.126648 |
| PSA | 67.87000 |
| LogP | 1.34 |
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
| Index of Refraction | 1.538 |
| InChIKey | FYKXWBBQYZXPFB-UHFFFAOYSA-N |
| SMILES | COC(=O)C1CN(C(=O)OCc2ccccc2)CCN1 |
| Storage condition | 2-8°C |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2933599090 |
|
~%
1-Benzyl 3-meth... CAS#:129799-11-7 |
| Literature: US6878700 B1, ; |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1-Benzyl 3-methyl 1,3-piperazinedicarboxylate |
| 1,3-Piperazinedicarboxylic acid, 3-methyl 1-(phenylmethyl) ester |
| 1-Benzyl 3-methyl piperazine-1,3-dicarboxylate |
| MFCD03001724 |
| 1-O-benzyl 3-O-methyl piperazine-1,3-dicarboxylate |