phenethyl alcohol xylopyranosyl-(1-6)-glucopyranoside structure
|
Common Name | phenethyl alcohol xylopyranosyl-(1-6)-glucopyranoside | ||
|---|---|---|---|---|
| CAS Number | 129932-48-5 | Molecular Weight | 416.42000 | |
| Density | 1.49g/cm3 | Boiling Point | 661.3ºC at 760mmHg | |
| Molecular Formula | C19H28O10 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 353.7ºC | |
Use of phenethyl alcohol xylopyranosyl-(1-6)-glucopyranoside2-Phenethyl β-primeveroside is a phenplic that can be isolated from Callianthemum taipaicum[1]. |
| Name | (2R,3R,4S,5S,6R)-2-(2-phenylethoxy)-6-[[(2S,3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]oxymethyl]oxane-3,4,5-triol |
|---|---|
| Synonym | More Synonyms |
| Description | 2-Phenethyl β-primeveroside is a phenplic that can be isolated from Callianthemum taipaicum[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.49g/cm3 |
|---|---|
| Boiling Point | 661.3ºC at 760mmHg |
| Molecular Formula | C19H28O10 |
| Molecular Weight | 416.42000 |
| Flash Point | 353.7ºC |
| Exact Mass | 416.16800 |
| PSA | 158.30000 |
| Vapour Pressure | 2.18E-18mmHg at 25°C |
| Index of Refraction | 1.625 |
| InChIKey | ZRGXCWYRIBRSQA-BMVMOQKNSA-N |
| SMILES | OC1COC(OCC2OC(OCCc3ccccc3)C(O)C(O)C2O)C(O)C1O |
| Precursor 9 | |
|---|---|
| DownStream 2 | |
| paxgp |