Phenylethyl β-D-galactopyranoside structure
|
Common Name | Phenylethyl β-D-galactopyranoside | ||
|---|---|---|---|---|
| CAS Number | 14861-16-6 | Molecular Weight | 284.30500 | |
| Density | 1.36g/cm3 | Boiling Point | 486.8ºC at 760 mmHg | |
| Molecular Formula | C14H20O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 248.2ºC | |
Use of Phenylethyl β-D-galactopyranoside2-Phenylethyl β-D-galactopyranoside (Phenethyl β-D-galactoside) can be synthesized catalyzed by Aspergillus oryzae β-galactosidase[1]. |
| Name | PHENYLETHYL-β-D-GALACTOSIDE |
|---|---|
| Synonym | More Synonyms |
| Description | 2-Phenylethyl β-D-galactopyranoside (Phenethyl β-D-galactoside) can be synthesized catalyzed by Aspergillus oryzae β-galactosidase[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.36g/cm3 |
|---|---|
| Boiling Point | 486.8ºC at 760 mmHg |
| Molecular Formula | C14H20O6 |
| Molecular Weight | 284.30500 |
| Flash Point | 248.2ºC |
| Exact Mass | 284.12600 |
| PSA | 99.38000 |
| Vapour Pressure | 2.73E-10mmHg at 25°C |
| Index of Refraction | 1.6 |
| InChIKey | MLRIJUWUQTVDQE-MBJXGIAVSA-N |
| SMILES | OCC1OC(OCCc2ccccc2)C(O)C(O)C1O |
| Storage condition | −20°C |
| WGK Germany | 3 |
|---|
| Precursor 9 | |
|---|---|
| DownStream 3 | |
| 2-Phenylethyl |A-D-Glucoside |
| |A-Phenylethanol Glucoside |
| Phenethyl |A-D-Glucoside |
| Phenylethyl 2-Glucoside |
| Phenethyl |A-D-Glucopyranoside |
| |A-Phenylethyl |A-D-Glucoside |