n-methoxy-n-methyl(triphenyl-phosphoranylidene)acetamide structure
|
Common Name | n-methoxy-n-methyl(triphenyl-phosphoranylidene)acetamide | ||
|---|---|---|---|---|
| CAS Number | 129986-67-0 | Molecular Weight | 363.38900 | |
| Density | 1.18g/cm3 | Boiling Point | 495.6ºC at 760 mmHg | |
| Molecular Formula | C22H22NO2P | Melting Point | 183ºC | |
| MSDS | Chinese USA | Flash Point | 253.5ºC | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | n-methoxy-n-methyl(triphenyl-phosphoranylidene)acetamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.18g/cm3 |
|---|---|
| Boiling Point | 495.6ºC at 760 mmHg |
| Melting Point | 183ºC |
| Molecular Formula | C22H22NO2P |
| Molecular Weight | 363.38900 |
| Flash Point | 253.5ºC |
| Exact Mass | 363.13900 |
| PSA | 39.35000 |
| LogP | 2.80250 |
| Vapour Pressure | 5.83E-10mmHg at 25°C |
| Index of Refraction | 1.612 |
| InChIKey | DGBLSOOPDBHHRX-UHFFFAOYSA-N |
| SMILES | CON(C)C(=O)C=P(c1ccccc1)(c1ccccc1)c1ccccc1 |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi: Irritant; |
| Risk Phrases | 36/37/38 |
| Safety Phrases | 26-36 |
| RIDADR | NONH for all modes of transport |
| PPh3PCHCON(Me)OMe2Et |
| (N-methoxymethylaminocarbonylmethylene)triphenylphosphoran |
| Ph3P=CHCON(Me)(OMe) |
| [N-METHOXYMETHYLAMINOCARBONYLMETHYLENE]-TRIPHENYLPHOSPHORANE |
| N-methoxy-N-methyl 2-(triphenylphosphoranylidene) acetamide |
| Ph3P=CHC(O)N(OMe)Me |
| MFCD00134433 |
| N-methoxy-N-methylamino(triphenylphosphoranylidene)acetamide |