Sodium 3,4-dimethylbenzenesulfonate structure
|
Common Name | Sodium 3,4-dimethylbenzenesulfonate | ||
|---|---|---|---|---|
| CAS Number | 1300-72-7 | Molecular Weight | 208.210 | |
| Density | 1.17 g/mL at 25 °C | Boiling Point | 157°C | |
| Molecular Formula | C8H9NaO3S | Melting Point | 27°C | |
| MSDS | Chinese USA | Flash Point | N/A | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | Sodium xylenesulfonate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.17 g/mL at 25 °C |
|---|---|
| Boiling Point | 157°C |
| Melting Point | 27°C |
| Molecular Formula | C8H9NaO3S |
| Molecular Weight | 208.210 |
| Exact Mass | 208.017014 |
| PSA | 65.58000 |
| LogP | 2.28830 |
| Index of Refraction | n20/D 1.405 |
| InChIKey | QUCDWLYKDRVKMI-UHFFFAOYSA-M |
| SMILES | Cc1ccc(S(=O)(=O)[O-])cc1C.[Na+] |
| Stability | Stable. Combustible. Incompatible with acids, oxidizing agents. Moisture-sensitive. |
| Water Solubility | >=10 g/100 mL at 20 ºC |
CHEMICAL IDENTIFICATION
|
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H319 |
| Precautionary Statements | P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi:Irritant |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S36-S37/39 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 1 |
| RTECS | ZE5100000 |
| HS Code | 2904100000 |
| HS Code | 2904100000 |
|---|---|
| Summary | 2904100000 derivatives containing only sulpho groups, their salts and ethyl esters。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
|
NTP Toxicology and Carcinogenesis Studies of Technical Grade Sodium Xylenesulfonate (CAS No. 1300-72-7) in F344/N Rats and B6C3F1 Mice (Dermal Studies).
Natl. Toxicol. Program Tech. Rep. Ser. 464 , 1-272, (1998) Sodium xylenesulfonate is used as a hydrotrope, an organic compound that increases the ability of water to dissolve other molecules. Sodium xylenesulfonate is a component in a variety of widely used s... |
| concosxs |
| EINECS 215-090-9 |
| stepanatex |
| Benzenesulfonic acid, 3,4-dimethyl-, sodium salt (1:1) |
| Xylenesulfonic Acid Sodium Salt |
| NAXONATE 5L |
| benzenesulfonic acid, 3,4-dimethyl-, sodium salt |
| SXS |
| NAXONATE SX |
| naxonateg |
| MFCD00007513 |
| Sodium 3,4-dimethylbenzenesulfonate |
| hydrotrope |
| naxonate |
| surcosxs |