Eberconazole nitrate structure
|
Common Name | Eberconazole nitrate | ||
|---|---|---|---|---|
| CAS Number | 130104-32-4 | Molecular Weight | 392.236 | |
| Density | N/A | Boiling Point | 495ºC at 760 mmHg | |
| Molecular Formula | C18H15Cl2N3O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 253.2ºC | |
Use of Eberconazole nitrateEberconazole nitrate is a dichlorinated imidazole derivative with antifungal activity. Eberconazole nitrate is more active than Clotrimazole, Ketoconazole, and Miconazole. Eberconazole nitrate has the potential for the research of dermatophytoses with a topical administration[1]. |
| Name | 1-(1,3-dichloro-6,11-dihydro-5H-dibenzo[1,2-a:1',4'-e][7]annulen-11-yl)imidazole,nitric acid |
|---|---|
| Synonym | More Synonyms |
| Description | Eberconazole nitrate is a dichlorinated imidazole derivative with antifungal activity. Eberconazole nitrate is more active than Clotrimazole, Ketoconazole, and Miconazole. Eberconazole nitrate has the potential for the research of dermatophytoses with a topical administration[1]. |
|---|---|
| Related Catalog | |
| References |
| Boiling Point | 495ºC at 760 mmHg |
|---|---|
| Molecular Formula | C18H15Cl2N3O3 |
| Molecular Weight | 392.236 |
| Flash Point | 253.2ºC |
| Exact Mass | 391.049042 |
| PSA | 83.87000 |
| LogP | 5.10170 |
| Vapour Pressure | 1.86E-09mmHg at 25°C |
| InChIKey | DPHMSVRBAXJSPF-UHFFFAOYSA-N |
| SMILES | Clc1cc(Cl)c2c(c1)CCc1ccccc1C2n1ccnc1.O=[N+]([O-])O |
| 1H-Imidazole, 1-(2,4-dichloro-10,11-dihydro-5H-dibenzo[a,d]cyclohepten-5-yl)-, nitrate (1:1) |
| 1-(2,4-Dichloro-10,11-dihydro-5H-dibenzo[a,d][7]annulen-5-yl)-1H-imidazole nitrate (1:1) |
| Eberconazole nitrate |